Fmoc-(R)-3-Amino-4,4-diphenyl-butyric acid
Fmoc-(R)-3-Amino-4,4-diphenyl-butyric acid structure
|
Common Name | Fmoc-(R)-3-Amino-4,4-diphenyl-butyric acid | ||
|---|---|---|---|---|
| CAS Number | 332062-10-9 | Molecular Weight | 477.550 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 691.3±55.0 °C at 760 mmHg | |
| Molecular Formula | C31H27NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 371.9±31.5 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | fmoc-(r)-3-amino-4,4-diphenyl-butyric acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 691.3±55.0 °C at 760 mmHg |
| Molecular Formula | C31H27NO4 |
| Molecular Weight | 477.550 |
| Flash Point | 371.9±31.5 °C |
| Exact Mass | 477.194000 |
| PSA | 89.62000 |
| LogP | 7.49 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
| Index of Refraction | 1.635 |
| InChIKey | GQRZIYGFRVKFSB-MUUNZHRXSA-N |
| SMILES | O=C(O)CC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(c1ccccc1)c1ccccc1 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| fmoc-(r)-3-amino-4,4-diphenylbutanoic acid |
| rarechem ak pt f001 |
| (3R)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4,4-diphenylbutanoic acid |
| fmoc-d-dph-(c*ch2)oh |
| n-(9-fluorenylmethoxycarbonyl)-(r)-3-amino-4,4-diphenyl-butanoic acid |
| fmoc-(r)-3-amino-4,4-diphenyl-butyricacid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of fmoc-(r)-3-amino-4,4-diphenyl-butyric acid? |
| A: Boiling point of fmoc-(r)-3-amino-4,4-diphenyl-butyric acid is 691.3±55.0 °C at 760 mmHg. |
| Q: What English synonyms does fmoc-(r)-3-amino-4,4-diphenyl-butyric acid have? |
| A: English synonyms of fmoc-(r)-3-amino-4,4-diphenyl-butyric acid: fmoc-(r)-3-amino-4,4-diphenylbutanoic acid, rarechem ak pt f001, (3R)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4,4-diphenylbutanoic acid, fmoc-d-dph-(c*ch2)oh, n-(9-fluorenylmethoxycarbonyl)-(r)-3-amino-4,4-diphenyl-butanoic acid, fmoc-(r)-3-amino-4,4-diphenyl-butyricacid. |
| Q: What is the CAS number of fmoc-(r)-3-amino-4,4-diphenyl-butyric acid? |
| A: CAS number of fmoc-(r)-3-amino-4,4-diphenyl-butyric acid is 332062-10-9. |
| Q: What is the SMILES notation of fmoc-(r)-3-amino-4,4-diphenyl-butyric acid? |
| A: SMILES notation of fmoc-(r)-3-amino-4,4-diphenyl-butyric acid is O=C(O)CC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(c1ccccc1)c1ccccc1. |
| Q: What is the English name of fmoc-(r)-3-amino-4,4-diphenyl-butyric acid? |
| A: The English name of fmoc-(r)-3-amino-4,4-diphenyl-butyric acid is fmoc-(r)-3-amino-4,4-diphenyl-butyric acid. |
| Q: What is the InChIKey of fmoc-(r)-3-amino-4,4-diphenyl-butyric acid? |
| A: InChIKey of fmoc-(r)-3-amino-4,4-diphenyl-butyric acid is GQRZIYGFRVKFSB-MUUNZHRXSA-N. |
| Q: What is the LogP of fmoc-(r)-3-amino-4,4-diphenyl-butyric acid? |
| A: LogP of fmoc-(r)-3-amino-4,4-diphenyl-butyric acid is 7.49. |
| Q: What is the molecular formula of fmoc-(r)-3-amino-4,4-diphenyl-butyric acid? |
| A: Molecular formula of fmoc-(r)-3-amino-4,4-diphenyl-butyric acid is C31H27NO4. |
| Q: What is the polar surface area (PSA) of fmoc-(r)-3-amino-4,4-diphenyl-butyric acid? |
| A: Polar surface area (PSA) of fmoc-(r)-3-amino-4,4-diphenyl-butyric acid is 89.62000. |
| Q: What is the molecular weight of fmoc-(r)-3-amino-4,4-diphenyl-butyric acid? |
| A: Molecular weight of fmoc-(r)-3-amino-4,4-diphenyl-butyric acid is 477.550. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |