4-bromo-2,5-dimethoxybenzoic acid
4-bromo-2,5-dimethoxybenzoic acid structure
|
Common Name | 4-bromo-2,5-dimethoxybenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 35458-39-0 | Molecular Weight | 261.06900 | |
| Density | 1.571g/cm3 | Boiling Point | 358.78ºC at 760 mmHg | |
| Molecular Formula | C9H9BrO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.784ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-bromo-2,5-dimethoxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.571g/cm3 |
|---|---|
| Boiling Point | 358.78ºC at 760 mmHg |
| Molecular Formula | C9H9BrO4 |
| Molecular Weight | 261.06900 |
| Flash Point | 170.784ºC |
| Exact Mass | 259.96800 |
| PSA | 55.76000 |
| LogP | 2.16450 |
| Index of Refraction | 1.566 |
| InChIKey | LNIJFUCQBPDEIV-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)O)c(OC)cc1Br |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2918990090 |
|---|
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-bromo-2,5-dimethoxy-benzoic acid |
| Benzoic acid,4-bromo-2,5-dimethoxy |
| 4-Brom-2,5-dimethoxy-benzoesaeure |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 4-bromo-2,5-dimethoxybenzoic acid have? |
| A: English synonyms of 4-bromo-2,5-dimethoxybenzoic acid: 4-bromo-2,5-dimethoxy-benzoic acid, Benzoic acid,4-bromo-2,5-dimethoxy, 4-Brom-2,5-dimethoxy-benzoesaeure. |
| Q: What is the molecular weight of 4-bromo-2,5-dimethoxybenzoic acid? |
| A: Molecular weight of 4-bromo-2,5-dimethoxybenzoic acid is 261.06900. |
| Q: What is the CAS number of 4-bromo-2,5-dimethoxybenzoic acid? |
| A: CAS number of 4-bromo-2,5-dimethoxybenzoic acid is 35458-39-0. |
| Q: What is the boiling point of 4-bromo-2,5-dimethoxybenzoic acid? |
| A: Boiling point of 4-bromo-2,5-dimethoxybenzoic acid is 358.78ºC at 760 mmHg. |
| Q: What is the InChIKey of 4-bromo-2,5-dimethoxybenzoic acid? |
| A: InChIKey of 4-bromo-2,5-dimethoxybenzoic acid is LNIJFUCQBPDEIV-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 4-bromo-2,5-dimethoxybenzoic acid? |
| A: Polar surface area (PSA) of 4-bromo-2,5-dimethoxybenzoic acid is 55.76000. |
| Q: What is the molecular formula of 4-bromo-2,5-dimethoxybenzoic acid? |
| A: Molecular formula of 4-bromo-2,5-dimethoxybenzoic acid is C9H9BrO4. |
| Q: What is the LogP of 4-bromo-2,5-dimethoxybenzoic acid? |
| A: LogP of 4-bromo-2,5-dimethoxybenzoic acid is 2.16450. |
| Q: What is the SMILES notation of 4-bromo-2,5-dimethoxybenzoic acid? |
| A: SMILES notation of 4-bromo-2,5-dimethoxybenzoic acid is COc1cc(C(=O)O)c(OC)cc1Br. |
| Q: What is the English name of 4-bromo-2,5-dimethoxybenzoic acid? |
| A: The English name of 4-bromo-2,5-dimethoxybenzoic acid is 4-bromo-2,5-dimethoxybenzoic acid. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |