3-Methoxy-5-methylphenylboronic acid pinacol ester
3-Methoxy-5-methylphenylboronic acid pinacol ester structure
|
Common Name | 3-Methoxy-5-methylphenylboronic acid pinacol ester | ||
|---|---|---|---|---|
| CAS Number | 365564-09-6 | Molecular Weight | 248.12600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H21BO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anisole |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H21BO3 |
|---|---|
| Molecular Weight | 248.12600 |
| Exact Mass | 248.15800 |
| PSA | 27.69000 |
| LogP | 2.30280 |
| InChIKey | XBGRLNYRWRLBAI-UHFFFAOYSA-N |
| SMILES | COc1cc(C)cc(B2OC(C)(C)C(C)(C)O2)c1 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-(3-methoxy-5-methylphenyl)-4,4,5,5,-tetramethyl-1,3,2-dioxoborolane |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anisole? |
| A: LogP of 3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anisole is 2.30280. |
| Q: What is the Chinese name of 365564-09-6? |
| A: Chinese name of 365564-09-6 is 365564-09-6. |
| Q: What is the polar surface area (PSA) of 3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anisole? |
| A: Polar surface area (PSA) of 3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anisole is 27.69000. |
| Q: What is the molecular weight of 3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anisole? |
| A: Molecular weight of 3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anisole is 248.12600. |
| Q: What is the English name of 3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anisole? |
| A: The English name of 3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anisole is 3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anisole. |
| Q: What is the InChIKey of 3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anisole? |
| A: InChIKey of 3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anisole is XBGRLNYRWRLBAI-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anisole? |
| A: Molecular formula of 3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anisole is C14H21BO3. |
| Q: What is the SMILES notation of 3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anisole? |
| A: SMILES notation of 3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anisole is COc1cc(C)cc(B2OC(C)(C)C(C)(C)O2)c1. |
| Q: What is the CAS number of 3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anisole? |
| A: CAS number of 3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anisole is 365564-09-6. |
| Q: What English synonyms does 3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anisole have? |
| A: English synonyms of 3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anisole: 2-(3-methoxy-5-methylphenyl)-4,4,5,5,-tetramethyl-1,3,2-dioxoborolane. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |