5-Hydroxy-1H-indole-3-carboxylic acid structure
|
Common Name | 5-Hydroxy-1H-indole-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 3705-21-3 | Molecular Weight | 177.157 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 511.4±30.0 °C at 760 mmHg | |
| Molecular Formula | C9H7NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 263.1±24.6 °C | |
| Name | 5-Hydroxy-1H-indole-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 511.4±30.0 °C at 760 mmHg |
| Molecular Formula | C9H7NO3 |
| Molecular Weight | 177.157 |
| Flash Point | 263.1±24.6 °C |
| Exact Mass | 177.042587 |
| PSA | 73.32000 |
| LogP | 0.82 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.780 |
| InChIKey | RVWZUOPFHTYIEO-UHFFFAOYSA-N |
| SMILES | O=C(O)c1c[nH]c2ccc(O)cc12 |
| HS Code | 2933990090 |
|---|
|
~%
5-Hydroxy-1H-in... CAS#:3705-21-3 |
| Literature: Kimmig et al. Hoppe-Seyler's Zeitschrift fuer Physiologische Chemie, 1958 , vol. 311, p. 234,237 |
|
~%
5-Hydroxy-1H-in... CAS#:3705-21-3 |
| Literature: Kimmig et al. Hoppe-Seyler's Zeitschrift fuer Physiologische Chemie, 1958 , vol. 311, p. 234,237 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-hydroxyindoleacetic acid |
| 5-hydroxy-indole-3-carboxylic acid |
| Indole-3-carboxylic acid,5-hydroxy |
| 5-Hydroxy-1H-indole-3-carboxylic acid |
| 5-Hydroxy-indol-3-carbonsaeure |