2-bromo-4,4'-dichlorobutyrophenone
2-bromo-4,4'-dichlorobutyrophenone structure
|
Common Name | 2-bromo-4,4'-dichlorobutyrophenone | ||
|---|---|---|---|---|
| CAS Number | 3760-66-5 | Molecular Weight | 295.98800 | |
| Density | 1.55g/cm3 | Boiling Point | 363.5ºC at 760mmHg | |
| Molecular Formula | C10H9BrCl2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.7ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-bromo-4-chloro-1-(4-chlorophenyl)butan-1-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.55g/cm3 |
|---|---|
| Boiling Point | 363.5ºC at 760mmHg |
| Molecular Formula | C10H9BrCl2O |
| Molecular Weight | 295.98800 |
| Flash Point | 173.7ºC |
| Exact Mass | 293.92100 |
| PSA | 17.07000 |
| LogP | 3.91510 |
| Index of Refraction | 1.573 |
| InChIKey | FJDWOHFEUUFTDH-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(Cl)cc1)C(Br)CCCl |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2914700090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2-bromo-4,4'-di... CAS#:3760-66-5 |
| Literature: Bayer Aktiengesellschaft Patent: US4921528 A1, 1990 ; |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-chlorophenyl 1-bromo-3-chloropropyl ketone |
| 2-Bromo-4,4'-dichlorobutyrophenone |
| 1-bromo-3-chloropropyl 4-chlorophenyl ketone |
| EINECS 223-176-2 |
| 2-bromo-4-chloro-1-(4-chlorophenyl)-butan-1-one |
| 4-chloro-phenyl 1-bromo-3-chloro-n-propyl ketone |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-bromo-4-chloro-1-(4-chlorophenyl)butan-1-one? |
| A: InChIKey of 2-bromo-4-chloro-1-(4-chlorophenyl)butan-1-one is FJDWOHFEUUFTDH-UHFFFAOYSA-N. |
| Q: What English synonyms does 2-bromo-4-chloro-1-(4-chlorophenyl)butan-1-one have? |
| A: English synonyms of 2-bromo-4-chloro-1-(4-chlorophenyl)butan-1-one: 4-chlorophenyl 1-bromo-3-chloropropyl ketone, 2-Bromo-4,4'-dichlorobutyrophenone, 1-bromo-3-chloropropyl 4-chlorophenyl ketone, EINECS 223-176-2, 2-bromo-4-chloro-1-(4-chlorophenyl)-butan-1-one, 4-chloro-phenyl 1-bromo-3-chloro-n-propyl ketone. |
| Q: What is the English name of 2-bromo-4-chloro-1-(4-chlorophenyl)butan-1-one? |
| A: The English name of 2-bromo-4-chloro-1-(4-chlorophenyl)butan-1-one is 2-bromo-4-chloro-1-(4-chlorophenyl)butan-1-one. |
| Q: What is the boiling point of 2-bromo-4-chloro-1-(4-chlorophenyl)butan-1-one? |
| A: Boiling point of 2-bromo-4-chloro-1-(4-chlorophenyl)butan-1-one is 363.5ºC at 760mmHg. |
| Q: What is the SMILES notation of 2-bromo-4-chloro-1-(4-chlorophenyl)butan-1-one? |
| A: SMILES notation of 2-bromo-4-chloro-1-(4-chlorophenyl)butan-1-one is O=C(c1ccc(Cl)cc1)C(Br)CCCl. |
| Q: What is the molecular weight of 2-bromo-4-chloro-1-(4-chlorophenyl)butan-1-one? |
| A: Molecular weight of 2-bromo-4-chloro-1-(4-chlorophenyl)butan-1-one is 295.98800. |
| Q: What is the CAS number of 2-bromo-4-chloro-1-(4-chlorophenyl)butan-1-one? |
| A: CAS number of 2-bromo-4-chloro-1-(4-chlorophenyl)butan-1-one is 3760-66-5. |
| Q: What are the upstream materials of 2-bromo-4-chloro-1-(4-chlorophenyl)butan-1-one? |
| A: Related upstream materials(CAS) of 2-bromo-4-chloro-1-(4-chlorophenyl)butan-1-one: 40877-09-6. |
| Q: What is the molecular formula of 2-bromo-4-chloro-1-(4-chlorophenyl)butan-1-one? |
| A: Molecular formula of 2-bromo-4-chloro-1-(4-chlorophenyl)butan-1-one is C10H9BrCl2O. |
| Q: What is the LogP of 2-bromo-4-chloro-1-(4-chlorophenyl)butan-1-one? |
| A: LogP of 2-bromo-4-chloro-1-(4-chlorophenyl)butan-1-one is 3.91510. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |