Ethyl 3-chloro-1H-indole-2-carboxylate
Ethyl 3-chloro-1H-indole-2-carboxylate structure
|
Common Name | Ethyl 3-chloro-1H-indole-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 38343-91-8 | Molecular Weight | 223.66 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 375.1±22.0 °C at 760 mmHg | |
| Molecular Formula | C11H10ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180.6±22.3 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ethyl 3-chloro-1H-indole-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 375.1±22.0 °C at 760 mmHg |
| Molecular Formula | C11H10ClNO2 |
| Molecular Weight | 223.66 |
| Flash Point | 180.6±22.3 °C |
| Exact Mass | 223.040009 |
| LogP | 3.39 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.630 |
| InChIKey | BSEGLNNFMGYNDX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1[nH]c2ccccc2c1Cl |
| Storage condition | 2-8°C |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| MFCD11106782 |
| Ethyl 3-chloro-1H-indole-2-carboxylate |
| 1H-Indole-2-carboxylic acid, 3-chloro-, ethyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of Ethyl 3-chloro-1H-indole-2-carboxylate? |
| A: Boiling point of Ethyl 3-chloro-1H-indole-2-carboxylate is 375.1±22.0 °C at 760 mmHg. |
| Q: What is the English name of Ethyl 3-chloro-1H-indole-2-carboxylate? |
| A: The English name of Ethyl 3-chloro-1H-indole-2-carboxylate is Ethyl 3-chloro-1H-indole-2-carboxylate. |
| Q: What is the CAS number of Ethyl 3-chloro-1H-indole-2-carboxylate? |
| A: CAS number of Ethyl 3-chloro-1H-indole-2-carboxylate is 38343-91-8. |
| Q: What English synonyms does Ethyl 3-chloro-1H-indole-2-carboxylate have? |
| A: English synonyms of Ethyl 3-chloro-1H-indole-2-carboxylate: MFCD11106782, Ethyl 3-chloro-1H-indole-2-carboxylate, 1H-Indole-2-carboxylic acid, 3-chloro-, ethyl ester. |
| Q: What are the storage conditions for Ethyl 3-chloro-1H-indole-2-carboxylate? |
| A: Storage conditions for Ethyl 3-chloro-1H-indole-2-carboxylate: 2-8°C. |
| Q: What is the InChIKey of Ethyl 3-chloro-1H-indole-2-carboxylate? |
| A: InChIKey of Ethyl 3-chloro-1H-indole-2-carboxylate is BSEGLNNFMGYNDX-UHFFFAOYSA-N. |
| Q: What is the LogP of Ethyl 3-chloro-1H-indole-2-carboxylate? |
| A: LogP of Ethyl 3-chloro-1H-indole-2-carboxylate is 3.39. |
| Q: What is the SMILES notation of Ethyl 3-chloro-1H-indole-2-carboxylate? |
| A: SMILES notation of Ethyl 3-chloro-1H-indole-2-carboxylate is CCOC(=O)c1[nH]c2ccccc2c1Cl. |
| Q: What is the molecular formula of Ethyl 3-chloro-1H-indole-2-carboxylate? |
| A: Molecular formula of Ethyl 3-chloro-1H-indole-2-carboxylate is C11H10ClNO2. |
| Q: What is the molecular weight of Ethyl 3-chloro-1H-indole-2-carboxylate? |
| A: Molecular weight of Ethyl 3-chloro-1H-indole-2-carboxylate is 223.66. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |