3-[2-(3-tert-butylureido)-3,3-dimethylbutyryl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid methyl ester
![3-[2-(3-tert-butylureido)-3,3-dimethylbutyryl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid methyl ester Structure](https://image.chemsrc.com/caspic/172/394735-26-3.png)
3-[2-(3-tert-butylureido)-3,3-dimethylbutyryl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid methyl ester structure
|
Common Name | 3-[2-(3-tert-butylureido)-3,3-dimethylbutyryl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 394735-26-3 | Molecular Weight | 382.49400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H34N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-[2-(3-tert-butylureido)-3,3-dimethylbutyryl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid methyl ester |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H34N2O5 |
|---|---|
| Molecular Weight | 382.49400 |
| Exact Mass | 382.24700 |
| PSA | 84.94000 |
| LogP | 2.91060 |
| InChIKey | AVAMRGOONZYOCL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1C2C(CN1C(=O)C(NC(=O)OC(C)(C)C)C(C)(C)C)C2(C)C |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:394730-60-0![(1S,2S,5R)-Methyl 3-((S)-2-(tert-butoxycarbonylamino)-3,3-dimethylbutanoyl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylate structure](https://image.chemsrc.com/caspic/134/394735-27-4.png)
CAS#:394735-27-4This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| boc-tert-Leu |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 3-[2-(3-tert-butylureido)-3,3-dimethylbutyryl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid methyl ester? |
| A: LogP of 3-[2-(3-tert-butylureido)-3,3-dimethylbutyryl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid methyl ester is 2.91060. |
| Q: What is the Chinese name of 394735-26-3? |
| A: Chinese name of 394735-26-3 is 394735-26-3. |
| Q: What is the molecular weight of 3-[2-(3-tert-butylureido)-3,3-dimethylbutyryl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid methyl ester? |
| A: Molecular weight of 3-[2-(3-tert-butylureido)-3,3-dimethylbutyryl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid methyl ester is 382.49400. |
| Q: What is the English name of 3-[2-(3-tert-butylureido)-3,3-dimethylbutyryl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid methyl ester? |
| A: The English name of 3-[2-(3-tert-butylureido)-3,3-dimethylbutyryl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid methyl ester is 3-[2-(3-tert-butylureido)-3,3-dimethylbutyryl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid methyl ester. |
| Q: What is the polar surface area (PSA) of 3-[2-(3-tert-butylureido)-3,3-dimethylbutyryl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid methyl ester? |
| A: Polar surface area (PSA) of 3-[2-(3-tert-butylureido)-3,3-dimethylbutyryl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid methyl ester is 84.94000. |
| Q: What is the CAS number of 3-[2-(3-tert-butylureido)-3,3-dimethylbutyryl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid methyl ester? |
| A: CAS number of 3-[2-(3-tert-butylureido)-3,3-dimethylbutyryl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid methyl ester is 394735-26-3. |
| Q: What English synonyms does 3-[2-(3-tert-butylureido)-3,3-dimethylbutyryl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid methyl ester have? |
| A: English synonyms of 3-[2-(3-tert-butylureido)-3,3-dimethylbutyryl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid methyl ester: boc-tert-Leu. |
| Q: What is the InChIKey of 3-[2-(3-tert-butylureido)-3,3-dimethylbutyryl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid methyl ester? |
| A: InChIKey of 3-[2-(3-tert-butylureido)-3,3-dimethylbutyryl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid methyl ester is AVAMRGOONZYOCL-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 3-[2-(3-tert-butylureido)-3,3-dimethylbutyryl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid methyl ester? |
| A: Molecular formula of 3-[2-(3-tert-butylureido)-3,3-dimethylbutyryl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid methyl ester is C20H34N2O5. |
| Q: What are the downstream products of 3-[2-(3-tert-butylureido)-3,3-dimethylbutyryl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid methyl ester? |
| A: Related downstream products(CAS) of 3-[2-(3-tert-butylureido)-3,3-dimethylbutyryl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid methyl ester: 394730-60-0;394735-27-4. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |