2,7-Dibromo-thioxanthen-9-one
2,7-Dibromo-thioxanthen-9-one structure
|
Common Name | 2,7-Dibromo-thioxanthen-9-one | ||
|---|---|---|---|---|
| CAS Number | 40102-86-1 | Molecular Weight | 370.05900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H6Br2OS | Melting Point | 268 °C | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,7-dibromo-9H-thioxanthene-9-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Melting Point | 268 °C |
|---|---|
| Molecular Formula | C13H6Br2OS |
| Molecular Weight | 370.05900 |
| Exact Mass | 367.85100 |
| PSA | 45.31000 |
| LogP | 4.93970 |
| InChIKey | MIGPGZSVGPGCCR-UHFFFAOYSA-N |
| SMILES | O=c1c2cc(Br)ccc2sc2ccc(Br)cc12 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,7-dibromo-9H-thioxanthen-9-one |
| 2,7-dibromothioxanthen-9-one |
| 2,7-Dibromothioxanthone |
| 2,7-dibromo-thioxanthen-9-one |
| 2,7-Dibrom-thioxanthon |
| 2,7-Dibromthioxanthon |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2,7-dibromo-9H-thioxanthene-9-one? |
| A: SMILES notation of 2,7-dibromo-9H-thioxanthene-9-one is O=c1c2cc(Br)ccc2sc2ccc(Br)cc12. |
| Q: What is the InChIKey of 2,7-dibromo-9H-thioxanthene-9-one? |
| A: InChIKey of 2,7-dibromo-9H-thioxanthene-9-one is MIGPGZSVGPGCCR-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 2,7-dibromo-9H-thioxanthene-9-one? |
| A: Polar surface area (PSA) of 2,7-dibromo-9H-thioxanthene-9-one is 45.31000. |
| Q: What is the English name of 2,7-dibromo-9H-thioxanthene-9-one? |
| A: The English name of 2,7-dibromo-9H-thioxanthene-9-one is 2,7-dibromo-9H-thioxanthene-9-one. |
| Q: What is the melting point of 2,7-dibromo-9H-thioxanthene-9-one? |
| A: Melting point of 2,7-dibromo-9H-thioxanthene-9-one is 268 °C. |
| Q: What is the molecular weight of 2,7-dibromo-9H-thioxanthene-9-one? |
| A: Molecular weight of 2,7-dibromo-9H-thioxanthene-9-one is 370.05900. |
| Q: What is the LogP of 2,7-dibromo-9H-thioxanthene-9-one? |
| A: LogP of 2,7-dibromo-9H-thioxanthene-9-one is 4.93970. |
| Q: What is the molecular formula of 2,7-dibromo-9H-thioxanthene-9-one? |
| A: Molecular formula of 2,7-dibromo-9H-thioxanthene-9-one is C13H6Br2OS. |
| Q: What is the CAS number of 2,7-dibromo-9H-thioxanthene-9-one? |
| A: CAS number of 2,7-dibromo-9H-thioxanthene-9-one is 40102-86-1. |
| Q: What English synonyms does 2,7-dibromo-9H-thioxanthene-9-one have? |
| A: English synonyms of 2,7-dibromo-9H-thioxanthene-9-one: 2,7-dibromo-9H-thioxanthen-9-one, 2,7-dibromothioxanthen-9-one, 2,7-Dibromothioxanthone, 2,7-dibromo-thioxanthen-9-one, 2,7-Dibrom-thioxanthon, 2,7-Dibromthioxanthon. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |