methyl 5-formyl-6-methoxypyridine-2-carboxylate
methyl 5-formyl-6-methoxypyridine-2-carboxylate structure
|
Common Name | methyl 5-formyl-6-methoxypyridine-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 401792-87-8 | Molecular Weight | 195.17200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 5-formyl-6-methoxypyridine-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H9NO4 |
|---|---|
| Molecular Weight | 195.17200 |
| Exact Mass | 195.05300 |
| PSA | 65.49000 |
| LogP | 0.68930 |
| InChIKey | ALLQYZZOVMXXLZ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(C=O)c(OC)n1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 0 | |
CAS#:67-56-1
CAS#:201230-82-2
CAS#:95652-81-6
CAS#:401792-84-5
CAS#:2402-78-0
CAS#:17228-64-7
CAS#:589-93-5
CAS#:29681-38-7
CAS#:401792-77-6
CAS#:401792-80-1This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| METHYL 5-FORMYL-6-METHOXY-2-PYRIDINECARBOXYLATE |
| 5-Formyl-6-methoxy-pyridine-2-carboxylic acid methyl ester |
| methyl 5-formyl-6-methoxypicolinate |
| 5-FORMYL-6-METHOXY-2-PYRIDINECARBOXYLIC ACID METHYL ESTER |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of methyl 5-formyl-6-methoxypyridine-2-carboxylate? |
| A: Related upstream materials(CAS) of methyl 5-formyl-6-methoxypyridine-2-carboxylate: 67-56-1;201230-82-2;95652-81-6;401792-84-5;2402-78-0;17228-64-7;589-93-5;29681-38-7;401792-77-6;401792-80-1. |
| Q: What is the polar surface area (PSA) of methyl 5-formyl-6-methoxypyridine-2-carboxylate? |
| A: Polar surface area (PSA) of methyl 5-formyl-6-methoxypyridine-2-carboxylate is 65.49000. |
| Q: What is the InChIKey of methyl 5-formyl-6-methoxypyridine-2-carboxylate? |
| A: InChIKey of methyl 5-formyl-6-methoxypyridine-2-carboxylate is ALLQYZZOVMXXLZ-UHFFFAOYSA-N. |
| Q: What is the molecular weight of methyl 5-formyl-6-methoxypyridine-2-carboxylate? |
| A: Molecular weight of methyl 5-formyl-6-methoxypyridine-2-carboxylate is 195.17200. |
| Q: What English synonyms does methyl 5-formyl-6-methoxypyridine-2-carboxylate have? |
| A: English synonyms of methyl 5-formyl-6-methoxypyridine-2-carboxylate: METHYL 5-FORMYL-6-METHOXY-2-PYRIDINECARBOXYLATE, 5-Formyl-6-methoxy-pyridine-2-carboxylic acid methyl ester, methyl 5-formyl-6-methoxypicolinate, 5-FORMYL-6-METHOXY-2-PYRIDINECARBOXYLIC ACID METHYL ESTER. |
| Q: What is the molecular formula of methyl 5-formyl-6-methoxypyridine-2-carboxylate? |
| A: Molecular formula of methyl 5-formyl-6-methoxypyridine-2-carboxylate is C9H9NO4. |
| Q: What is the English name of methyl 5-formyl-6-methoxypyridine-2-carboxylate? |
| A: The English name of methyl 5-formyl-6-methoxypyridine-2-carboxylate is methyl 5-formyl-6-methoxypyridine-2-carboxylate. |
| Q: What is the CAS number of methyl 5-formyl-6-methoxypyridine-2-carboxylate? |
| A: CAS number of methyl 5-formyl-6-methoxypyridine-2-carboxylate is 401792-87-8. |
| Q: What is the LogP of methyl 5-formyl-6-methoxypyridine-2-carboxylate? |
| A: LogP of methyl 5-formyl-6-methoxypyridine-2-carboxylate is 0.68930. |
| Q: What is the SMILES notation of methyl 5-formyl-6-methoxypyridine-2-carboxylate? |
| A: SMILES notation of methyl 5-formyl-6-methoxypyridine-2-carboxylate is COC(=O)c1ccc(C=O)c(OC)n1. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |