2-acetoxybenzoyl-N-(thiazol-2-yl)amide
2-acetoxybenzoyl-N-(thiazol-2-yl)amide structure
|
Common Name | 2-acetoxybenzoyl-N-(thiazol-2-yl)amide | ||
|---|---|---|---|---|
| CAS Number | 402848-76-4 | Molecular Weight | 262.28400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-acetoxybenzoyl-N-(thiazol-2-yl)amide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H10N2O3S |
|---|---|
| Molecular Weight | 262.28400 |
| Exact Mass | 262.04100 |
| PSA | 96.53000 |
| LogP | 2.39370 |
| InChIKey | GXWWYCHNNUHFAL-UHFFFAOYSA-N |
| SMILES | CC(=O)Oc1ccccc1C(=O)Nc1nccs1 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-acetoxy-benzoic acid thiazol-2-ylamide |
| 2-Acetoxy-benzoesaeure-thiazol-2-ylamid |
| 2-(1,3-thiazol-2-ylcarbamoyl)phenyl acetate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-acetoxybenzoyl-N-(thiazol-2-yl)amide? |
| A: CAS number of 2-acetoxybenzoyl-N-(thiazol-2-yl)amide is 402848-76-4. |
| Q: What is the SMILES notation of 2-acetoxybenzoyl-N-(thiazol-2-yl)amide? |
| A: SMILES notation of 2-acetoxybenzoyl-N-(thiazol-2-yl)amide is CC(=O)Oc1ccccc1C(=O)Nc1nccs1. |
| Q: What is the InChIKey of 2-acetoxybenzoyl-N-(thiazol-2-yl)amide? |
| A: InChIKey of 2-acetoxybenzoyl-N-(thiazol-2-yl)amide is GXWWYCHNNUHFAL-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 2-acetoxybenzoyl-N-(thiazol-2-yl)amide? |
| A: Polar surface area (PSA) of 2-acetoxybenzoyl-N-(thiazol-2-yl)amide is 96.53000. |
| Q: What is the molecular weight of 2-acetoxybenzoyl-N-(thiazol-2-yl)amide? |
| A: Molecular weight of 2-acetoxybenzoyl-N-(thiazol-2-yl)amide is 262.28400. |
| Q: What is the English name of 2-acetoxybenzoyl-N-(thiazol-2-yl)amide? |
| A: The English name of 2-acetoxybenzoyl-N-(thiazol-2-yl)amide is 2-acetoxybenzoyl-N-(thiazol-2-yl)amide. |
| Q: What is the molecular formula of 2-acetoxybenzoyl-N-(thiazol-2-yl)amide? |
| A: Molecular formula of 2-acetoxybenzoyl-N-(thiazol-2-yl)amide is C12H10N2O3S. |
| Q: What is the LogP of 2-acetoxybenzoyl-N-(thiazol-2-yl)amide? |
| A: LogP of 2-acetoxybenzoyl-N-(thiazol-2-yl)amide is 2.39370. |
| Q: What is the Chinese name of 402848-76-4? |
| A: Chinese name of 402848-76-4 is 402848-76-4. |
| Q: What English synonyms does 2-acetoxybenzoyl-N-(thiazol-2-yl)amide have? |
| A: English synonyms of 2-acetoxybenzoyl-N-(thiazol-2-yl)amide: 2-acetoxy-benzoic acid thiazol-2-ylamide, 2-Acetoxy-benzoesaeure-thiazol-2-ylamid, 2-(1,3-thiazol-2-ylcarbamoyl)phenyl acetate. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |