4-(2-Bromoacetyl)phenylacetate
4-(2-Bromoacetyl)phenylacetate structure
|
Common Name | 4-(2-Bromoacetyl)phenylacetate | ||
|---|---|---|---|---|
| CAS Number | 41104-10-3 | Molecular Weight | 257.08100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H9BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 4-(2-Bromoacetyl)phenylacetate (CAS number: 41104-10-3, molecular formula: C10H9BrO3, molecular weight: 257.08100). For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-acetyloxyphenacyl bromide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H9BrO3 |
|---|---|
| Molecular Weight | 257.08100 |
| Exact Mass | 255.97400 |
| PSA | 43.37000 |
| LogP | 2.18950 |
| InChIKey | SPCDJZGDCHUTIM-UHFFFAOYSA-N |
| SMILES | CC(=O)Oc1ccc(C(=O)CBr)cc1 |
| Storage condition | 2-8°C |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 3 | |
CAS#:30686-73-8
CAS#:2491-38-5![1-(4-HYDROXY-PHENYL)-2-([2-(4-HYDROXY-PHENYL)-2-OXO-ETHYL]-PHENYL-AMINO)-ETHANONE structure](https://image.chemsrc.com/caspic/126/119658-52-5.png)
CAS#:119658-52-5This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-(4-acetoxy-phenyl)-2-bromo-ethanone |
| acetic acid 4-(2-bromo-acetyl)-phenyl ester |
| 1-(4-Acetoxy-phenyl)-2-brom-aethanon |
| 4-acetoxy-α-bromoacetophenone |
| p-acetoxyphenacyl bromide |
| 4-acetoxylphenacyl bromide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 4-acetyloxyphenacyl bromide? |
| A: Molecular formula of 4-acetyloxyphenacyl bromide is C10H9BrO3. |
| Q: What is the molecular weight of 4-acetyloxyphenacyl bromide? |
| A: Molecular weight of 4-acetyloxyphenacyl bromide is 257.08100. |
| Q: What is the LogP of 4-acetyloxyphenacyl bromide? |
| A: LogP of 4-acetyloxyphenacyl bromide is 2.18950. |
| Q: What are the storage conditions for 4-acetyloxyphenacyl bromide? |
| A: Storage conditions for 4-acetyloxyphenacyl bromide: 2-8°C. |
| Q: What is the polar surface area (PSA) of 4-acetyloxyphenacyl bromide? |
| A: Polar surface area (PSA) of 4-acetyloxyphenacyl bromide is 43.37000. |
| Q: What is the English name of 4-acetyloxyphenacyl bromide? |
| A: The English name of 4-acetyloxyphenacyl bromide is 4-acetyloxyphenacyl bromide. |
| Q: What is the SMILES notation of 4-acetyloxyphenacyl bromide? |
| A: SMILES notation of 4-acetyloxyphenacyl bromide is CC(=O)Oc1ccc(C(=O)CBr)cc1. |
| Q: What is the InChIKey of 4-acetyloxyphenacyl bromide? |
| A: InChIKey of 4-acetyloxyphenacyl bromide is SPCDJZGDCHUTIM-UHFFFAOYSA-N. |
| Q: What are the downstream products of 4-acetyloxyphenacyl bromide? |
| A: Related downstream products(CAS) of 4-acetyloxyphenacyl bromide: 30686-73-8;2491-38-5;119658-52-5. |
| Q: What is the CAS number of 4-acetyloxyphenacyl bromide? |
| A: CAS number of 4-acetyloxyphenacyl bromide is 41104-10-3. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |