3-Chloro-4-ethylnitrobenzene
3-Chloro-4-ethylnitrobenzene structure
|
Common Name | 3-Chloro-4-ethylnitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 42782-54-7 | Molecular Weight | 185.60800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H8ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-Chloro-4-ethylnitrobenzene |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H8ClNO2 |
|---|---|
| Molecular Weight | 185.60800 |
| Exact Mass | 185.02400 |
| PSA | 45.82000 |
| LogP | 3.33380 |
| InChIKey | YOIYZHDXMDAXOA-UHFFFAOYSA-N |
| SMILES | CCc1ccc([N+](=O)[O-])cc1Cl |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:67818-41-1This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 3-Chloro-4-ethylnitrobenzene? |
| A: CAS number of 3-Chloro-4-ethylnitrobenzene is 42782-54-7. |
| Q: What are the downstream products of 3-Chloro-4-ethylnitrobenzene? |
| A: Related downstream products(CAS) of 3-Chloro-4-ethylnitrobenzene: 67818-41-1. |
| Q: What is the English name of 3-Chloro-4-ethylnitrobenzene? |
| A: The English name of 3-Chloro-4-ethylnitrobenzene is 3-Chloro-4-ethylnitrobenzene. |
| Q: What is the InChIKey of 3-Chloro-4-ethylnitrobenzene? |
| A: InChIKey of 3-Chloro-4-ethylnitrobenzene is YOIYZHDXMDAXOA-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 3-Chloro-4-ethylnitrobenzene? |
| A: Polar surface area (PSA) of 3-Chloro-4-ethylnitrobenzene is 45.82000. |
| Q: What is the molecular formula of 3-Chloro-4-ethylnitrobenzene? |
| A: Molecular formula of 3-Chloro-4-ethylnitrobenzene is C8H8ClNO2. |
| Q: What is the LogP of 3-Chloro-4-ethylnitrobenzene? |
| A: LogP of 3-Chloro-4-ethylnitrobenzene is 3.33380. |
| Q: What is the SMILES notation of 3-Chloro-4-ethylnitrobenzene? |
| A: SMILES notation of 3-Chloro-4-ethylnitrobenzene is CCc1ccc([N+](=O)[O-])cc1Cl. |
| Q: What is the molecular weight of 3-Chloro-4-ethylnitrobenzene? |
| A: Molecular weight of 3-Chloro-4-ethylnitrobenzene is 185.60800. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |