trimethyl butane-1,2,4-tricarboxylate
trimethyl butane-1,2,4-tricarboxylate structure
|
Common Name | trimethyl butane-1,2,4-tricarboxylate | ||
|---|---|---|---|---|
| CAS Number | 4339-27-9 | Molecular Weight | 232.23000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H16O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 3-甲基己烷-2,3,5-三羧酸 (Trimethyl butane-1,2,4-tricarboxylate, CAS: 4339-27-9), molecular formula C10H16O6, molecular weight 232.23000. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | trimethyl butane-1,2,4-tricarboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H16O6 |
|---|---|
| Molecular Weight | 232.23000 |
| Exact Mass | 232.09500 |
| PSA | 78.90000 |
| LogP | 0.29190 |
| InChIKey | DVHJCQNSPXZHEC-UHFFFAOYSA-N |
| SMILES | COC(=O)CCC(CC(=O)OC)C(=O)OC |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:923-42-2
CAS#:143817-34-9This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| butane-1,2,4-tricarboxylic acid trimethyl ester |
| Trimethyl 1,2,4-butanetricarboxylate |
| 1,2,4-trimethoxycarbonylbutane |
| 1,2,4-Butanetricarboxylicacid,1,2,4-trimethyl ester |
| methylester of 1,2,4-butanetricarboxylic acid |
| Butan-1,2,4-tricarbonsaeure-trimethylester |
| 1,2,4-tricarbomethoxybutane |
| 1,2,4-Butanetricarboxylic acid,trimethyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of trimethyl butane-1,2,4-tricarboxylate? |
| A: Molecular formula of trimethyl butane-1,2,4-tricarboxylate is C10H16O6. |
| Q: What is the molecular weight of trimethyl butane-1,2,4-tricarboxylate? |
| A: Molecular weight of trimethyl butane-1,2,4-tricarboxylate is 232.23000. |
| Q: What is the SMILES notation of trimethyl butane-1,2,4-tricarboxylate? |
| A: SMILES notation of trimethyl butane-1,2,4-tricarboxylate is COC(=O)CCC(CC(=O)OC)C(=O)OC. |
| Q: What is the polar surface area (PSA) of trimethyl butane-1,2,4-tricarboxylate? |
| A: Polar surface area (PSA) of trimethyl butane-1,2,4-tricarboxylate is 78.90000. |
| Q: What is the CAS number of trimethyl butane-1,2,4-tricarboxylate? |
| A: CAS number of trimethyl butane-1,2,4-tricarboxylate is 4339-27-9. |
| Q: What is the English name of trimethyl butane-1,2,4-tricarboxylate? |
| A: The English name of trimethyl butane-1,2,4-tricarboxylate is trimethyl butane-1,2,4-tricarboxylate. |
| Q: What is the InChIKey of trimethyl butane-1,2,4-tricarboxylate? |
| A: InChIKey of trimethyl butane-1,2,4-tricarboxylate is DVHJCQNSPXZHEC-UHFFFAOYSA-N. |
| Q: What English synonyms does trimethyl butane-1,2,4-tricarboxylate have? |
| A: English synonyms of trimethyl butane-1,2,4-tricarboxylate: butane-1,2,4-tricarboxylic acid trimethyl ester, Trimethyl 1,2,4-butanetricarboxylate, 1,2,4-trimethoxycarbonylbutane, 1,2,4-Butanetricarboxylicacid,1,2,4-trimethyl ester, methylester of 1,2,4-butanetricarboxylic acid, Butan-1,2,4-tricarbonsaeure-trimethylester, 1,2,4-tricarbomethoxybutane, 1,2,4-Butanetricarboxylic acid,trimethyl ester. |
| Q: What is the LogP of trimethyl butane-1,2,4-tricarboxylate? |
| A: LogP of trimethyl butane-1,2,4-tricarboxylate is 0.29190. |
| Q: What are the downstream products of trimethyl butane-1,2,4-tricarboxylate? |
| A: Related downstream products(CAS) of trimethyl butane-1,2,4-tricarboxylate: 923-42-2;143817-34-9. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |