4-Nitrophenylglyoxal hydrate
4-Nitrophenylglyoxal hydrate structure
|
Common Name | 4-Nitrophenylglyoxal hydrate | ||
|---|---|---|---|---|
| CAS Number | 4974-57-6 | Molecular Weight | 179.13000 | |
| Density | 1.376g/cm3 | Boiling Point | 321.4ºC at 760mmHg | |
| Molecular Formula | C8H5NO4 | Melting Point | 96-98°C (lit.) | |
| MSDS | N/A | Flash Point | 163ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(4-nitrophenyl)-2-oxoacetaldehyde |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.376g/cm3 |
|---|---|
| Boiling Point | 321.4ºC at 760mmHg |
| Melting Point | 96-98°C (lit.) |
| Molecular Formula | C8H5NO4 |
| Molecular Weight | 179.13000 |
| Flash Point | 163ºC |
| Exact Mass | 179.02200 |
| PSA | 79.96000 |
| LogP | 1.49960 |
| Index of Refraction | 1.575 |
| InChIKey | ILVKBBGIGNSVDO-UHFFFAOYSA-N |
| SMILES | O=CC(=O)c1ccc([N+](=O)[O-])cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 6 | |
|---|---|
| DownStream 3 | |
CAS#:100-19-6
CAS#:4996-22-9
CAS#:99-81-0
CAS#:110944-98-4
CAS#:1439-43-6
CAS#:1044637-41-3
CAS#:24342-44-7![(E)-3-PHENYL-1-(4-[(E)-(3-PHENYL-ACRYLOYL)]-PHENYL)-PROPENONE structure](https://image.chemsrc.com/caspic/128/63104-97-2.png)
CAS#:63104-97-2This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| para-Nitrophenylglyoxal |
| 2-oxo-2-(4-nitrophenyl)acetaldehyde |
| p-NO2-phenylglyoxal |
| (4-nitro-phenyl)-oxo-acetaldehyde |
| 4-Nitrophenylglyoxal hydrate |
| p-NITROPHENYLGLYOXAL |
| 4-Nitrophenylglyoxal |
| p-nitrophenylglyoxal monohydrate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-(4-nitrophenyl)-2-oxoacetaldehyde? |
| A: CAS number of 2-(4-nitrophenyl)-2-oxoacetaldehyde is 4974-57-6. |
| Q: What are the downstream products of 2-(4-nitrophenyl)-2-oxoacetaldehyde? |
| A: Related downstream products(CAS) of 2-(4-nitrophenyl)-2-oxoacetaldehyde: 4996-22-9;24342-44-7;63104-97-2. |
| Q: What is the English name of 2-(4-nitrophenyl)-2-oxoacetaldehyde? |
| A: The English name of 2-(4-nitrophenyl)-2-oxoacetaldehyde is 2-(4-nitrophenyl)-2-oxoacetaldehyde. |
| Q: What is the melting point of 2-(4-nitrophenyl)-2-oxoacetaldehyde? |
| A: Melting point of 2-(4-nitrophenyl)-2-oxoacetaldehyde is 96-98°C (lit.). |
| Q: What is the boiling point of 2-(4-nitrophenyl)-2-oxoacetaldehyde? |
| A: Boiling point of 2-(4-nitrophenyl)-2-oxoacetaldehyde is 321.4ºC at 760mmHg. |
| Q: What is the SMILES notation of 2-(4-nitrophenyl)-2-oxoacetaldehyde? |
| A: SMILES notation of 2-(4-nitrophenyl)-2-oxoacetaldehyde is O=CC(=O)c1ccc([N+](=O)[O-])cc1. |
| Q: What is the molecular formula of 2-(4-nitrophenyl)-2-oxoacetaldehyde? |
| A: Molecular formula of 2-(4-nitrophenyl)-2-oxoacetaldehyde is C8H5NO4. |
| Q: What is the LogP of 2-(4-nitrophenyl)-2-oxoacetaldehyde? |
| A: LogP of 2-(4-nitrophenyl)-2-oxoacetaldehyde is 1.49960. |
| Q: What English synonyms does 2-(4-nitrophenyl)-2-oxoacetaldehyde have? |
| A: English synonyms of 2-(4-nitrophenyl)-2-oxoacetaldehyde: para-Nitrophenylglyoxal, 2-oxo-2-(4-nitrophenyl)acetaldehyde, p-NO2-phenylglyoxal, (4-nitro-phenyl)-oxo-acetaldehyde, 4-Nitrophenylglyoxal hydrate, p-NITROPHENYLGLYOXAL, 4-Nitrophenylglyoxal, p-nitrophenylglyoxal monohydrate. |
| Q: What is the polar surface area (PSA) of 2-(4-nitrophenyl)-2-oxoacetaldehyde? |
| A: Polar surface area (PSA) of 2-(4-nitrophenyl)-2-oxoacetaldehyde is 79.96000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |