3-chloro-2-methyl-6-nitrobenzonitrile
3-chloro-2-methyl-6-nitrobenzonitrile structure
|
Common Name | 3-chloro-2-methyl-6-nitrobenzonitrile | ||
|---|---|---|---|---|
| CAS Number | 51123-60-5 | Molecular Weight | 196.59000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H5ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 3-Chloro-2-methyl-6-nitrobenzonitrile (CAS号：51123-60-5)，分子式：C8H5ClN2O2，分子量：196.59000。For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-chloro-2-methyl-6-nitrobenzonitrile |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H5ClN2O2 |
|---|---|
| Molecular Weight | 196.59000 |
| Exact Mass | 196.00400 |
| PSA | 69.61000 |
| LogP | 2.95148 |
| InChIKey | IMRNPVPCQHLOAI-UHFFFAOYSA-N |
| SMILES | Cc1c(Cl)ccc([N+](=O)[O-])c1C#N |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
3-chloro-2-meth... CAS#:51123-60-5 |
| Literature: Aventis Pharma Deutschland GmbH Patent: US6211196 B1, 2001 ; |
|
~%
3-chloro-2-meth... CAS#:51123-60-5 |
| Literature: Heitsch, Holger; Wagner, Adalbert; Schoelkens, Bernward A.; Wirth, Klaus Bioorganic and Medicinal Chemistry Letters, 1999 , vol. 9, # 3 p. 327 - 332 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Benzonitrile,3-chloro-2-methyl-6-nitro |
| 2-methyl-3-chloro-6-nitrobenzonitrile |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 3-chloro-2-methyl-6-nitrobenzonitrile? |
| A: The English name of 3-chloro-2-methyl-6-nitrobenzonitrile is 3-chloro-2-methyl-6-nitrobenzonitrile. |
| Q: What are the upstream materials of 3-chloro-2-methyl-6-nitrobenzonitrile? |
| A: Related upstream materials(CAS) of 3-chloro-2-methyl-6-nitrobenzonitrile: 29682-46-0;544-92-3. |
| Q: What is the InChIKey of 3-chloro-2-methyl-6-nitrobenzonitrile? |
| A: InChIKey of 3-chloro-2-methyl-6-nitrobenzonitrile is IMRNPVPCQHLOAI-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 3-chloro-2-methyl-6-nitrobenzonitrile? |
| A: Molecular formula of 3-chloro-2-methyl-6-nitrobenzonitrile is C8H5ClN2O2. |
| Q: What is the CAS number of 3-chloro-2-methyl-6-nitrobenzonitrile? |
| A: CAS number of 3-chloro-2-methyl-6-nitrobenzonitrile is 51123-60-5. |
| Q: What is the molecular weight of 3-chloro-2-methyl-6-nitrobenzonitrile? |
| A: Molecular weight of 3-chloro-2-methyl-6-nitrobenzonitrile is 196.59000. |
| Q: What English synonyms does 3-chloro-2-methyl-6-nitrobenzonitrile have? |
| A: English synonyms of 3-chloro-2-methyl-6-nitrobenzonitrile: Benzonitrile,3-chloro-2-methyl-6-nitro, 2-methyl-3-chloro-6-nitrobenzonitrile. |
| Q: What is the polar surface area (PSA) of 3-chloro-2-methyl-6-nitrobenzonitrile? |
| A: Polar surface area (PSA) of 3-chloro-2-methyl-6-nitrobenzonitrile is 69.61000. |
| Q: What is the LogP of 3-chloro-2-methyl-6-nitrobenzonitrile? |
| A: LogP of 3-chloro-2-methyl-6-nitrobenzonitrile is 2.95148. |
| Q: What is the SMILES notation of 3-chloro-2-methyl-6-nitrobenzonitrile? |
| A: SMILES notation of 3-chloro-2-methyl-6-nitrobenzonitrile is Cc1c(Cl)ccc([N+](=O)[O-])c1C#N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |