Fmoc-(R)-3-Amino-3-(1-naphthyl)-propionic acid
Fmoc-(R)-3-Amino-3-(1-naphthyl)-propionic acid structure
|
Common Name | Fmoc-(R)-3-Amino-3-(1-naphthyl)-propionic acid | ||
|---|---|---|---|---|
| CAS Number | 511272-47-2 | Molecular Weight | 437.48700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H23NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-naphthalen-1-ylpropanoic acid, also known as Fmoc-(R)-3-Amino-3-(1-naphthyl)-propionic acid, has a CAS number of 511272-47-2 and a molecular formula of C28H23NO4. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-naphthalen-1-ylpropanoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C28H23NO4 |
|---|---|
| Molecular Weight | 437.48700 |
| Exact Mass | 437.16300 |
| PSA | 75.63000 |
| LogP | 6.28520 |
| InChIKey | YQHVLHLQDDNYKX-AREMUKBSSA-N |
| SMILES | O=C(O)CC(NC(=O)OCC1c2ccccc2-c2ccccc21)c1cccc2ccccc12 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
CAS#:186581-53-3
CAS#:24608-52-4This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Fmoc-(R)-3-Amino-3-(1-naphthyl)-propionic acid |
| (R)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(naphthalen-1-yl)propanoic acid |
| FMOC-GLY(1-NAPH)-(C*CH2)OH |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-naphthalen-1-ylpropanoic acid? |
| A: CAS number of (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-naphthalen-1-ylpropanoic acid is 511272-47-2. |
| Q: What is the polar surface area (PSA) of (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-naphthalen-1-ylpropanoic acid? |
| A: Polar surface area (PSA) of (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-naphthalen-1-ylpropanoic acid is 75.63000. |
| Q: What is the SMILES notation of (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-naphthalen-1-ylpropanoic acid? |
| A: SMILES notation of (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-naphthalen-1-ylpropanoic acid is O=C(O)CC(NC(=O)OCC1c2ccccc2-c2ccccc21)c1cccc2ccccc12. |
| Q: What are the upstream materials of (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-naphthalen-1-ylpropanoic acid? |
| A: Related upstream materials(CAS) of (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-naphthalen-1-ylpropanoic acid: 186581-53-3;24608-52-4. |
| Q: What English synonyms does (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-naphthalen-1-ylpropanoic acid have? |
| A: English synonyms of (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-naphthalen-1-ylpropanoic acid: Fmoc-(R)-3-Amino-3-(1-naphthyl)-propionic acid, (R)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(naphthalen-1-yl)propanoic acid, FMOC-GLY(1-NAPH)-(C*CH2)OH. |
| Q: What is the molecular formula of (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-naphthalen-1-ylpropanoic acid? |
| A: Molecular formula of (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-naphthalen-1-ylpropanoic acid is C28H23NO4. |
| Q: What is the InChIKey of (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-naphthalen-1-ylpropanoic acid? |
| A: InChIKey of (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-naphthalen-1-ylpropanoic acid is YQHVLHLQDDNYKX-AREMUKBSSA-N. |
| Q: What is the molecular weight of (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-naphthalen-1-ylpropanoic acid? |
| A: Molecular weight of (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-naphthalen-1-ylpropanoic acid is 437.48700. |
| Q: What is the LogP of (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-naphthalen-1-ylpropanoic acid? |
| A: LogP of (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-naphthalen-1-ylpropanoic acid is 6.28520. |
| Q: What is the English name of (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-naphthalen-1-ylpropanoic acid? |
| A: The English name of (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-naphthalen-1-ylpropanoic acid is (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-naphthalen-1-ylpropanoic acid. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |