5-methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid
5-methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid structure
|
Common Name | 5-methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 53568-17-5 | Molecular Weight | 206.23800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H14O3 |
|---|---|
| Molecular Weight | 206.23800 |
| Exact Mass | 206.09400 |
| PSA | 46.53000 |
| LogP | 1.88470 |
| InChIKey | WYCIVOOAIQZDGE-UHFFFAOYSA-N |
| SMILES | COc1cccc2c1CCC(C(=O)O)C2 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1.2.3.4-Tetrahydro-5-methoxy-2-naphthoesaeure |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 5-methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid? |
| A: LogP of 5-methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid is 1.88470. |
| Q: What is the polar surface area (PSA) of 5-methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid? |
| A: Polar surface area (PSA) of 5-methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid is 46.53000. |
| Q: What is the molecular weight of 5-methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid? |
| A: Molecular weight of 5-methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid is 206.23800. |
| Q: What is the molecular formula of 5-methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid? |
| A: Molecular formula of 5-methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid is C12H14O3. |
| Q: What is the SMILES notation of 5-methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid? |
| A: SMILES notation of 5-methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid is COc1cccc2c1CCC(C(=O)O)C2. |
| Q: What English synonyms does 5-methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid have? |
| A: English synonyms of 5-methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid: 1.2.3.4-Tetrahydro-5-methoxy-2-naphthoesaeure. |
| Q: What is the English name of 5-methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid? |
| A: The English name of 5-methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid is 5-methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid. |
| Q: What is the InChIKey of 5-methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid? |
| A: InChIKey of 5-methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid is WYCIVOOAIQZDGE-UHFFFAOYSA-N. |
| Q: What is the CAS number of 5-methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid? |
| A: CAS number of 5-methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid is 53568-17-5. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |