(2S)-2-(4-Chlorophenyl)-3-methylbutanoic acid
(2S)-2-(4-Chlorophenyl)-3-methylbutanoic acid structure
|
Common Name | (2S)-2-(4-Chlorophenyl)-3-methylbutanoic acid | ||
|---|---|---|---|---|
| CAS Number | 55332-38-2 | Molecular Weight | 212.673 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 318.7±17.0 °C at 760 mmHg | |
| Molecular Formula | C11H13ClO2 | Melting Point | 89-91 °C | |
| MSDS | N/A | Flash Point | 146.5±20.9 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (S)-2-(4-Chlorophenyl)-3-methylbutanoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 318.7±17.0 °C at 760 mmHg |
| Melting Point | 89-91 °C |
| Molecular Formula | C11H13ClO2 |
| Molecular Weight | 212.673 |
| Flash Point | 146.5±20.9 °C |
| Exact Mass | 212.060410 |
| PSA | 37.30000 |
| LogP | 3.33 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.538 |
| InChIKey | VTJMSIIXXKNIDJ-JTQLQIEISA-N |
| SMILES | CC(C)C(C(=O)O)c1ccc(Cl)cc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:66230-04-4This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (2S)-2-(4-Chlorophenyl)-3-methylbutanoic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does (S)-2-(4-Chlorophenyl)-3-methylbutanoic acid have? |
| A: English synonyms of (S)-2-(4-Chlorophenyl)-3-methylbutanoic acid: (2S)-2-(4-Chlorophenyl)-3-methylbutanoic acid. |
| Q: What is the CAS number of (S)-2-(4-Chlorophenyl)-3-methylbutanoic acid? |
| A: CAS number of (S)-2-(4-Chlorophenyl)-3-methylbutanoic acid is 55332-38-2. |
| Q: What is the polar surface area (PSA) of (S)-2-(4-Chlorophenyl)-3-methylbutanoic acid? |
| A: Polar surface area (PSA) of (S)-2-(4-Chlorophenyl)-3-methylbutanoic acid is 37.30000. |
| Q: What is the InChIKey of (S)-2-(4-Chlorophenyl)-3-methylbutanoic acid? |
| A: InChIKey of (S)-2-(4-Chlorophenyl)-3-methylbutanoic acid is VTJMSIIXXKNIDJ-JTQLQIEISA-N. |
| Q: What is the boiling point of (S)-2-(4-Chlorophenyl)-3-methylbutanoic acid? |
| A: Boiling point of (S)-2-(4-Chlorophenyl)-3-methylbutanoic acid is 318.7±17.0 °C at 760 mmHg. |
| Q: What is the melting point of (S)-2-(4-Chlorophenyl)-3-methylbutanoic acid? |
| A: Melting point of (S)-2-(4-Chlorophenyl)-3-methylbutanoic acid is 89-91 °C. |
| Q: What is the SMILES notation of (S)-2-(4-Chlorophenyl)-3-methylbutanoic acid? |
| A: SMILES notation of (S)-2-(4-Chlorophenyl)-3-methylbutanoic acid is CC(C)C(C(=O)O)c1ccc(Cl)cc1. |
| Q: What are the downstream products of (S)-2-(4-Chlorophenyl)-3-methylbutanoic acid? |
| A: Related downstream products(CAS) of (S)-2-(4-Chlorophenyl)-3-methylbutanoic acid: 66230-04-4. |
| Q: What is the molecular weight of (S)-2-(4-Chlorophenyl)-3-methylbutanoic acid? |
| A: Molecular weight of (S)-2-(4-Chlorophenyl)-3-methylbutanoic acid is 212.673. |
| Q: What is the molecular formula of (S)-2-(4-Chlorophenyl)-3-methylbutanoic acid? |
| A: Molecular formula of (S)-2-(4-Chlorophenyl)-3-methylbutanoic acid is C11H13ClO2. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |