4-Methyl-5-Nitro-2-Pyridinecarboxylic Acid
4-Methyl-5-Nitro-2-Pyridinecarboxylic Acid structure
|
Common Name | 4-Methyl-5-Nitro-2-Pyridinecarboxylic Acid | ||
|---|---|---|---|---|
| CAS Number | 5832-43-9 | Molecular Weight | 182.13400 | |
| Density | 1.477g/cm3 | Boiling Point | 388.667ºC at 760 mmHg | |
| Molecular Formula | C7H6N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.859ºC | |
Summary: 4-Methyl-5-Nitro-2-Pyridinecarboxylic acid (CAS号：5832-43-9) is a chemical with the molecular formula C7H6N2O4 and a molecular weight of 182.13400. Its boiling point is 388.667ºC and it should be stored at 2-8°C. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-methyl-5-nitropyridine-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.477g/cm3 |
|---|---|
| Boiling Point | 388.667ºC at 760 mmHg |
| Molecular Formula | C7H6N2O4 |
| Molecular Weight | 182.13400 |
| Flash Point | 188.859ºC |
| Exact Mass | 182.03300 |
| PSA | 96.01000 |
| LogP | 1.51960 |
| Index of Refraction | 1.608 |
| InChIKey | WRCSKWMCSRGUTG-UHFFFAOYSA-N |
| SMILES | Cc1cc(C(=O)O)ncc1[N+](=O)[O-] |
| Storage condition | 2-8°C |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2933399090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~95%
4-Methyl-5-Nitr... CAS#:5832-43-9 |
| Literature: Synthesis, , # 3 p. 295 - 297 |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| RW1159 |
| 4-Methyl-5-nitro-2-pyridinecarboxylic acid |
| 4-Methyl-5-nitro-pyridin-2-carbonsaeure |
| 4-methyl-5-nitro-pyridine-2-carboxylic acid |
| QC-3974 |
| 4-Methyl-5-nitropicolinic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 4-methyl-5-nitropyridine-2-carboxylic acid have? |
| A: English synonyms of 4-methyl-5-nitropyridine-2-carboxylic acid: RW1159, 4-Methyl-5-nitro-2-pyridinecarboxylic acid, 4-Methyl-5-nitro-pyridin-2-carbonsaeure, 4-methyl-5-nitro-pyridine-2-carboxylic acid, QC-3974, 4-Methyl-5-nitropicolinic acid. |
| Q: What are the storage conditions for 4-methyl-5-nitropyridine-2-carboxylic acid? |
| A: Storage conditions for 4-methyl-5-nitropyridine-2-carboxylic acid: 2-8°C. |
| Q: What is the boiling point of 4-methyl-5-nitropyridine-2-carboxylic acid? |
| A: Boiling point of 4-methyl-5-nitropyridine-2-carboxylic acid is 388.667ºC at 760 mmHg. |
| Q: What is the English name of 4-methyl-5-nitropyridine-2-carboxylic acid? |
| A: The English name of 4-methyl-5-nitropyridine-2-carboxylic acid is 4-methyl-5-nitropyridine-2-carboxylic acid. |
| Q: What is the CAS number of 4-methyl-5-nitropyridine-2-carboxylic acid? |
| A: CAS number of 4-methyl-5-nitropyridine-2-carboxylic acid is 5832-43-9. |
| Q: What is the LogP of 4-methyl-5-nitropyridine-2-carboxylic acid? |
| A: LogP of 4-methyl-5-nitropyridine-2-carboxylic acid is 1.51960. |
| Q: What is the InChIKey of 4-methyl-5-nitropyridine-2-carboxylic acid? |
| A: InChIKey of 4-methyl-5-nitropyridine-2-carboxylic acid is WRCSKWMCSRGUTG-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 4-methyl-5-nitropyridine-2-carboxylic acid? |
| A: Molecular weight of 4-methyl-5-nitropyridine-2-carboxylic acid is 182.13400. |
| Q: What is the polar surface area (PSA) of 4-methyl-5-nitropyridine-2-carboxylic acid? |
| A: Polar surface area (PSA) of 4-methyl-5-nitropyridine-2-carboxylic acid is 96.01000. |
| Q: What is the SMILES notation of 4-methyl-5-nitropyridine-2-carboxylic acid? |
| A: SMILES notation of 4-methyl-5-nitropyridine-2-carboxylic acid is Cc1cc(C(=O)O)ncc1[N+](=O)[O-]. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |