methyl 2-hydroxy-5,6,7,8-tetrahydronaphthalene-1-carboxylate
methyl 2-hydroxy-5,6,7,8-tetrahydronaphthalene-1-carboxylate structure
|
Common Name | methyl 2-hydroxy-5,6,7,8-tetrahydronaphthalene-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 59604-96-5 | Molecular Weight | 206.23800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 2-hydroxy-5,6,7,8-tetrahydronaphthalene-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H14O3 |
|---|---|
| Molecular Weight | 206.23800 |
| Exact Mass | 206.09400 |
| PSA | 46.53000 |
| LogP | 2.05760 |
| InChIKey | FGZPUQMMDVJQQN-UHFFFAOYSA-N |
| SMILES | COC(=O)c1c(O)ccc2c1CCCC2 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2918199090 |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 8 | |
|---|---|
| DownStream 0 | |
CAS#:947-65-9
CAS#:108-94-1![2-methoxy-5,6,7,8-tetrahydro-[1]naphthoic acid methyl ester Structure](https://image.chemsrc.com/caspic/299/59605-01-5.png)
CAS#:59605-01-5
CAS#:60346-40-9
CAS#:74590-75-3
CAS#:75-77-4
CAS#:39695-64-2
CAS#:56028-92-3This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
|
Name: Discovering small molecule activators of G protein-gated inwardly-rectifying potassiu...
Source: 15621
Target: G protein-activated inward rectifier potassium channel 2
External Id: VANDERBILT_HTS_GIRK2_MPD
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| F9995-0491 |
| 2-hydroxy-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid methyl ester |
| methyl 2-hydroxy-5,6,7,8-tetrahydro-1-naphthoate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of methyl 2-hydroxy-5,6,7,8-tetrahydronaphthalene-1-carboxylate? |
| A: Molecular weight of methyl 2-hydroxy-5,6,7,8-tetrahydronaphthalene-1-carboxylate is 206.23800. |
| Q: What is the polar surface area (PSA) of methyl 2-hydroxy-5,6,7,8-tetrahydronaphthalene-1-carboxylate? |
| A: Polar surface area (PSA) of methyl 2-hydroxy-5,6,7,8-tetrahydronaphthalene-1-carboxylate is 46.53000. |
| Q: What is the LogP of methyl 2-hydroxy-5,6,7,8-tetrahydronaphthalene-1-carboxylate? |
| A: LogP of methyl 2-hydroxy-5,6,7,8-tetrahydronaphthalene-1-carboxylate is 2.05760. |
| Q: What is the SMILES notation of methyl 2-hydroxy-5,6,7,8-tetrahydronaphthalene-1-carboxylate? |
| A: SMILES notation of methyl 2-hydroxy-5,6,7,8-tetrahydronaphthalene-1-carboxylate is COC(=O)c1c(O)ccc2c1CCCC2. |
| Q: What is the English name of methyl 2-hydroxy-5,6,7,8-tetrahydronaphthalene-1-carboxylate? |
| A: The English name of methyl 2-hydroxy-5,6,7,8-tetrahydronaphthalene-1-carboxylate is methyl 2-hydroxy-5,6,7,8-tetrahydronaphthalene-1-carboxylate. |
| Q: What English synonyms does methyl 2-hydroxy-5,6,7,8-tetrahydronaphthalene-1-carboxylate have? |
| A: English synonyms of methyl 2-hydroxy-5,6,7,8-tetrahydronaphthalene-1-carboxylate: F9995-0491, 2-hydroxy-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid methyl ester, methyl 2-hydroxy-5,6,7,8-tetrahydro-1-naphthoate. |
| Q: What is the CAS number of methyl 2-hydroxy-5,6,7,8-tetrahydronaphthalene-1-carboxylate? |
| A: CAS number of methyl 2-hydroxy-5,6,7,8-tetrahydronaphthalene-1-carboxylate is 59604-96-5. |
| Q: What are the upstream materials of methyl 2-hydroxy-5,6,7,8-tetrahydronaphthalene-1-carboxylate? |
| A: Related upstream materials(CAS) of methyl 2-hydroxy-5,6,7,8-tetrahydronaphthalene-1-carboxylate: 947-65-9;108-94-1;59605-01-5;60346-40-9;74590-75-3;75-77-4;39695-64-2;56028-92-3. |
| Q: What is the molecular formula of methyl 2-hydroxy-5,6,7,8-tetrahydronaphthalene-1-carboxylate? |
| A: Molecular formula of methyl 2-hydroxy-5,6,7,8-tetrahydronaphthalene-1-carboxylate is C12H14O3. |
| Q: What is the InChIKey of methyl 2-hydroxy-5,6,7,8-tetrahydronaphthalene-1-carboxylate? |
| A: InChIKey of methyl 2-hydroxy-5,6,7,8-tetrahydronaphthalene-1-carboxylate is FGZPUQMMDVJQQN-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |