7-(benzyloxy)-2,4-dichloro-6-methoxyquinazoline
7-(benzyloxy)-2,4-dichloro-6-methoxyquinazoline structure
|
Common Name | 7-(benzyloxy)-2,4-dichloro-6-methoxyquinazoline | ||
|---|---|---|---|---|
| CAS Number | 60771-18-8 | Molecular Weight | 335.18500 | |
| Density | N/A | Boiling Point | 447.6±45.0°C at 760 mmHg | |
| Molecular Formula | C16H12Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 2,4-dichloro-6-methoxy-7-phenylmethoxyquinazoline (Chinese name: 2,4-二氯-6-甲氧基-7-苯基甲氧基喹唑啉，CAS number: 60771-18-8)，molecular formula C16H12Cl2N2O2，molecular weight 335.18500. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,4-dichloro-6-methoxy-7-phenylmethoxyquinazoline |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Boiling Point | 447.6±45.0°C at 760 mmHg |
|---|---|
| Molecular Formula | C16H12Cl2N2O2 |
| Molecular Weight | 335.18500 |
| Exact Mass | 334.02800 |
| PSA | 44.24000 |
| LogP | 4.52420 |
| InChIKey | PTQCMUDKRFNQCR-UHFFFAOYSA-N |
| SMILES | COc1cc2c(Cl)nc(Cl)nc2cc1OCc1ccccc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2933990090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| MFCD16987836 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2,4-dichloro-6-methoxy-7-phenylmethoxyquinazoline? |
| A: Molecular formula of 2,4-dichloro-6-methoxy-7-phenylmethoxyquinazoline is C16H12Cl2N2O2. |
| Q: What English synonyms does 2,4-dichloro-6-methoxy-7-phenylmethoxyquinazoline have? |
| A: English synonyms of 2,4-dichloro-6-methoxy-7-phenylmethoxyquinazoline: MFCD16987836. |
| Q: What is the boiling point of 2,4-dichloro-6-methoxy-7-phenylmethoxyquinazoline? |
| A: Boiling point of 2,4-dichloro-6-methoxy-7-phenylmethoxyquinazoline is 447.6±45.0°C at 760 mmHg. |
| Q: What is the InChIKey of 2,4-dichloro-6-methoxy-7-phenylmethoxyquinazoline? |
| A: InChIKey of 2,4-dichloro-6-methoxy-7-phenylmethoxyquinazoline is PTQCMUDKRFNQCR-UHFFFAOYSA-N. |
| Q: What is the English name of 2,4-dichloro-6-methoxy-7-phenylmethoxyquinazoline? |
| A: The English name of 2,4-dichloro-6-methoxy-7-phenylmethoxyquinazoline is 2,4-dichloro-6-methoxy-7-phenylmethoxyquinazoline. |
| Q: What is the polar surface area (PSA) of 2,4-dichloro-6-methoxy-7-phenylmethoxyquinazoline? |
| A: Polar surface area (PSA) of 2,4-dichloro-6-methoxy-7-phenylmethoxyquinazoline is 44.24000. |
| Q: What is the LogP of 2,4-dichloro-6-methoxy-7-phenylmethoxyquinazoline? |
| A: LogP of 2,4-dichloro-6-methoxy-7-phenylmethoxyquinazoline is 4.52420. |
| Q: What is the molecular weight of 2,4-dichloro-6-methoxy-7-phenylmethoxyquinazoline? |
| A: Molecular weight of 2,4-dichloro-6-methoxy-7-phenylmethoxyquinazoline is 335.18500. |
| Q: What is the SMILES notation of 2,4-dichloro-6-methoxy-7-phenylmethoxyquinazoline? |
| A: SMILES notation of 2,4-dichloro-6-methoxy-7-phenylmethoxyquinazoline is COc1cc2c(Cl)nc(Cl)nc2cc1OCc1ccccc1. |
| Q: What is the CAS number of 2,4-dichloro-6-methoxy-7-phenylmethoxyquinazoline? |
| A: CAS number of 2,4-dichloro-6-methoxy-7-phenylmethoxyquinazoline is 60771-18-8. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |