4-(CYANOSULFANYL)-3-NITROBENZOIC ACID
4-(CYANOSULFANYL)-3-NITROBENZOIC ACID structure
|
Common Name | 4-(CYANOSULFANYL)-3-NITROBENZOIC ACID | ||
|---|---|---|---|---|
| CAS Number | 6083-79-0 | Molecular Weight | 224.19300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H4N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-nitro-4-thiocyanato-benzoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H4N2O4S |
|---|---|
| Molecular Weight | 224.19300 |
| Exact Mass | 223.98900 |
| PSA | 132.21000 |
| LogP | 2.38938 |
| InChIKey | HQDASRYDGNESOF-UHFFFAOYSA-N |
| SMILES | N#CSc1ccc(C(=O)O)cc1[N+](=O)[O-] |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:101084-95-1
CAS#:65474-97-7This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| MFCD01318041 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 3-nitro-4-thiocyanato-benzoic acid? |
| A: SMILES notation of 3-nitro-4-thiocyanato-benzoic acid is N#CSc1ccc(C(=O)O)cc1[N+](=O)[O-]. |
| Q: What is the molecular weight of 3-nitro-4-thiocyanato-benzoic acid? |
| A: Molecular weight of 3-nitro-4-thiocyanato-benzoic acid is 224.19300. |
| Q: What is the LogP of 3-nitro-4-thiocyanato-benzoic acid? |
| A: LogP of 3-nitro-4-thiocyanato-benzoic acid is 2.38938. |
| Q: What is the English name of 3-nitro-4-thiocyanato-benzoic acid? |
| A: The English name of 3-nitro-4-thiocyanato-benzoic acid is 3-nitro-4-thiocyanato-benzoic acid. |
| Q: What are the downstream products of 3-nitro-4-thiocyanato-benzoic acid? |
| A: Related downstream products(CAS) of 3-nitro-4-thiocyanato-benzoic acid: 101084-95-1;65474-97-7. |
| Q: What is the CAS number of 3-nitro-4-thiocyanato-benzoic acid? |
| A: CAS number of 3-nitro-4-thiocyanato-benzoic acid is 6083-79-0. |
| Q: What is the InChIKey of 3-nitro-4-thiocyanato-benzoic acid? |
| A: InChIKey of 3-nitro-4-thiocyanato-benzoic acid is HQDASRYDGNESOF-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 3-nitro-4-thiocyanato-benzoic acid? |
| A: Molecular formula of 3-nitro-4-thiocyanato-benzoic acid is C8H4N2O4S. |
| Q: What English synonyms does 3-nitro-4-thiocyanato-benzoic acid have? |
| A: English synonyms of 3-nitro-4-thiocyanato-benzoic acid: MFCD01318041. |
| Q: What is the polar surface area (PSA) of 3-nitro-4-thiocyanato-benzoic acid? |
| A: Polar surface area (PSA) of 3-nitro-4-thiocyanato-benzoic acid is 132.21000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |