6-(TRIFLUOROMETHYL)-2,3,4-TRIHYDRONAPHTHALEN-1-ONE
6-(TRIFLUOROMETHYL)-2,3,4-TRIHYDRONAPHTHALEN-1-ONE structure
|
Common Name | 6-(TRIFLUOROMETHYL)-2,3,4-TRIHYDRONAPHTHALEN-1-ONE | ||
|---|---|---|---|---|
| CAS Number | 62620-71-7 | Molecular Weight | 214.18400 | |
| Density | N/A | Boiling Point | 261.2±40.0°C at 760 mmHg | |
| Molecular Formula | C11H9F3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-(trifluoromethyl)-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Boiling Point | 261.2±40.0°C at 760 mmHg |
|---|---|
| Molecular Formula | C11H9F3O |
| Molecular Weight | 214.18400 |
| Exact Mass | 214.06100 |
| PSA | 17.07000 |
| LogP | 3.22440 |
| InChIKey | UHPCUZXSDJQOPS-UHFFFAOYSA-N |
| SMILES | O=C1CCCc2cc(C(F)(F)F)ccc21 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
6-(TRIFLUOROMET... CAS#:62620-71-7 |
| Literature: Sanofi-Aventis Patent: US6906080 B1, 2005 ; Location in patent: Page/Page column 15 ; |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| y9656 |
| 6-trifluoromethyl-3,4-dihydro-2h-naphthalen-1-one |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 6-(trifluoromethyl)-3,4-dihydro-2H-naphthalen-1-one? |
| A: The English name of 6-(trifluoromethyl)-3,4-dihydro-2H-naphthalen-1-one is 6-(trifluoromethyl)-3,4-dihydro-2H-naphthalen-1-one. |
| Q: What is the SMILES notation of 6-(trifluoromethyl)-3,4-dihydro-2H-naphthalen-1-one? |
| A: SMILES notation of 6-(trifluoromethyl)-3,4-dihydro-2H-naphthalen-1-one is O=C1CCCc2cc(C(F)(F)F)ccc21. |
| Q: What is the LogP of 6-(trifluoromethyl)-3,4-dihydro-2H-naphthalen-1-one? |
| A: LogP of 6-(trifluoromethyl)-3,4-dihydro-2H-naphthalen-1-one is 3.22440. |
| Q: What is the CAS number of 6-(trifluoromethyl)-3,4-dihydro-2H-naphthalen-1-one? |
| A: CAS number of 6-(trifluoromethyl)-3,4-dihydro-2H-naphthalen-1-one is 62620-71-7. |
| Q: What English synonyms does 6-(trifluoromethyl)-3,4-dihydro-2H-naphthalen-1-one have? |
| A: English synonyms of 6-(trifluoromethyl)-3,4-dihydro-2H-naphthalen-1-one: y9656, 6-trifluoromethyl-3,4-dihydro-2h-naphthalen-1-one. |
| Q: What is the molecular formula of 6-(trifluoromethyl)-3,4-dihydro-2H-naphthalen-1-one? |
| A: Molecular formula of 6-(trifluoromethyl)-3,4-dihydro-2H-naphthalen-1-one is C11H9F3O. |
| Q: What are the upstream materials of 6-(trifluoromethyl)-3,4-dihydro-2H-naphthalen-1-one? |
| A: Related upstream materials(CAS) of 6-(trifluoromethyl)-3,4-dihydro-2H-naphthalen-1-one: 145485-43-4. |
| Q: What is the polar surface area (PSA) of 6-(trifluoromethyl)-3,4-dihydro-2H-naphthalen-1-one? |
| A: Polar surface area (PSA) of 6-(trifluoromethyl)-3,4-dihydro-2H-naphthalen-1-one is 17.07000. |
| Q: What is the boiling point of 6-(trifluoromethyl)-3,4-dihydro-2H-naphthalen-1-one? |
| A: Boiling point of 6-(trifluoromethyl)-3,4-dihydro-2H-naphthalen-1-one is 261.2±40.0°C at 760 mmHg. |
| Q: What is the molecular weight of 6-(trifluoromethyl)-3,4-dihydro-2H-naphthalen-1-one? |
| A: Molecular weight of 6-(trifluoromethyl)-3,4-dihydro-2H-naphthalen-1-one is 214.18400. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |