1,3,5-Tris(4-biphenylyl)benzene
1,3,5-Tris(4-biphenylyl)benzene structure
|
Common Name | 1,3,5-Tris(4-biphenylyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 6326-64-3 | Molecular Weight | 534.68800 | |
| Density | 1.111g/cm3 | Boiling Point | 752ºC at 760 mmHg | |
| Molecular Formula | C42H30 | Melting Point | 236 °C | |
| MSDS | N/A | Flash Point | 413.7ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,3,5-tris(4-phenylphenyl)benzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.111g/cm3 |
|---|---|
| Boiling Point | 752ºC at 760 mmHg |
| Melting Point | 236 °C |
| Molecular Formula | C42H30 |
| Molecular Weight | 534.68800 |
| Flash Point | 413.7ºC |
| Exact Mass | 534.23500 |
| LogP | 11.68860 |
| Index of Refraction | 1.642 |
| InChIKey | MUVSTFBKPNZCNI-UHFFFAOYSA-N |
| SMILES | c1ccc(-c2ccc(-c3cc(-c4ccc(-c5ccccc5)cc4)cc(-c4ccc(-c5ccccc5)cc4)c3)cc2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 8 | |
|---|---|
| DownStream 1 | |
CAS#:92-91-1
CAS#:7511-49-1
CAS#:98-80-6
CAS#:151417-38-8
CAS#:29079-00-3
CAS#:626-44-8
CAS#:1591-31-7
CAS#:13329-40-3
CAS#:92-92-2This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,3,5-tri(biphenyl)benzene |
| 1,3,5-tris(4-biphenyl)benzene |
| 1,3,5-tris(p-bromomethylphenyl)benzene |
| 1,3,5-Tris(4-brommethylphenyl)benzol |
| 1,3,5-tris(p-biphenyl)benzene |
| 1,1':3',1''-Terphenyl,4,4''-bis(bromomethyl)-5'-[4-(bromomethyl)phenyl] |
| 1,3,5-tris(biphenyl-4-yl)benzene |
| 1,3,5-tris<4-(bromomethyl)phenyl>benzene |
| 1,3,5-tris[4-(phenyl)phenyl]benzene |
| 1,3,5-tris(1,1'-biphenyl-4-yl)benzene |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1,3,5-tris(4-phenylphenyl)benzene? |
| A: InChIKey of 1,3,5-tris(4-phenylphenyl)benzene is MUVSTFBKPNZCNI-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 1,3,5-tris(4-phenylphenyl)benzene? |
| A: Molecular weight of 1,3,5-tris(4-phenylphenyl)benzene is 534.68800. |
| Q: What is the molecular formula of 1,3,5-tris(4-phenylphenyl)benzene? |
| A: Molecular formula of 1,3,5-tris(4-phenylphenyl)benzene is C42H30. |
| Q: What is the LogP of 1,3,5-tris(4-phenylphenyl)benzene? |
| A: LogP of 1,3,5-tris(4-phenylphenyl)benzene is 11.68860. |
| Q: What is the melting point of 1,3,5-tris(4-phenylphenyl)benzene? |
| A: Melting point of 1,3,5-tris(4-phenylphenyl)benzene is 236 °C. |
| Q: What is the English name of 1,3,5-tris(4-phenylphenyl)benzene? |
| A: The English name of 1,3,5-tris(4-phenylphenyl)benzene is 1,3,5-tris(4-phenylphenyl)benzene. |
| Q: What are the downstream products of 1,3,5-tris(4-phenylphenyl)benzene? |
| A: Related downstream products(CAS) of 1,3,5-tris(4-phenylphenyl)benzene: 92-92-2. |
| Q: What are the upstream materials of 1,3,5-tris(4-phenylphenyl)benzene? |
| A: Related upstream materials(CAS) of 1,3,5-tris(4-phenylphenyl)benzene: 92-91-1;7511-49-1;98-80-6;151417-38-8;29079-00-3;626-44-8;1591-31-7;13329-40-3. |
| Q: What is the boiling point of 1,3,5-tris(4-phenylphenyl)benzene? |
| A: Boiling point of 1,3,5-tris(4-phenylphenyl)benzene is 752ºC at 760 mmHg. |
| Q: What is the SMILES notation of 1,3,5-tris(4-phenylphenyl)benzene? |
| A: SMILES notation of 1,3,5-tris(4-phenylphenyl)benzene is c1ccc(-c2ccc(-c3cc(-c4ccc(-c5ccccc5)cc4)cc(-c4ccc(-c5ccccc5)cc4)c3)cc2)cc1. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |