4-(4-cyanophenyl)disulfanylbenzonitrile structure
|
Common Name | 4-(4-cyanophenyl)disulfanylbenzonitrile | ||
|---|---|---|---|---|
| CAS Number | 6339-51-1 | Molecular Weight | 268.35700 | |
| Density | 1.35g/cm3 | Boiling Point | 453.8ºC at 760 mmHg | |
| Molecular Formula | C14H8N2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 228.3ºC | |
| Name | 4-[(4-cyanophenyl)disulfanyl]benzonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 453.8ºC at 760 mmHg |
| Molecular Formula | C14H8N2S2 |
| Molecular Weight | 268.35700 |
| Flash Point | 228.3ºC |
| Exact Mass | 268.01300 |
| PSA | 98.18000 |
| LogP | 4.22936 |
| Index of Refraction | 1.701 |
| InChIKey | BCUVQZBVGSXWCG-UHFFFAOYSA-N |
| SMILES | N#Cc1ccc(SSc2ccc(C#N)cc2)cc1 |
| Precursor 9 | |
|---|---|
| DownStream 2 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| bis(4-cyanophenyl)disulfane |
| Bis-(4-cyan-phenyl)-disulfid |
| Benzonitrile,4,4'-dithiobis |
| 4,4'-Disulfandiyl-di-benzonitril |
| 4,4'-disulfanediyldibenzonitrile |
| bis(4-cyanophenyl) disulfide |
| di-(4-cyanophenyl) disulfide |