2-(4-phenylphenyl)propanoic acid structure
|
Common Name | 2-(4-phenylphenyl)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 6341-72-6 | Molecular Weight | 226.27000 | |
| Density | 1.134g/cm3 | Boiling Point | 388.3ºC at 760 mmHg | |
| Molecular Formula | C15H14O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 285.1ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(4-phenylphenyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.134g/cm3 |
|---|---|
| Boiling Point | 388.3ºC at 760 mmHg |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.27000 |
| Flash Point | 285.1ºC |
| Exact Mass | 226.09900 |
| PSA | 37.30000 |
| LogP | 3.54170 |
| Index of Refraction | 1.582 |
| InChIKey | JALUUBQFLPUJMY-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)c1ccc(-c2ccccc2)cc1 |
| Storage condition | 2-8℃ |
This table summarizes toxicological test data, acute & chronic toxicity and ecological hazard parameters for this chemical.
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| RIDADR | UN 2811 6.1 / PGIII |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 6 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-(para-biphenyl)propanoic acid |
| (RS)-2-(4'-biphenylyl)propanoic acid |
| 2-(4-Biphenylyl)-propionic acid |
| p-Phenylhydratropic Acid |
| 2-(p-Biphenyl)propionic acid |
| 2-(Biphenyl-4-yl)propanoic acid |
| Biprofen |
| Flurbiprofen Impurity 1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-(4-phenylphenyl)propanoic acid? |
| A: Molecular formula of 2-(4-phenylphenyl)propanoic acid is C15H14O2. |
| Q: What is the LogP of 2-(4-phenylphenyl)propanoic acid? |
| A: LogP of 2-(4-phenylphenyl)propanoic acid is 3.54170. |
| Q: What is the molecular weight of 2-(4-phenylphenyl)propanoic acid? |
| A: Molecular weight of 2-(4-phenylphenyl)propanoic acid is 226.27000. |
| Q: What English synonyms does 2-(4-phenylphenyl)propanoic acid have? |
| A: English synonyms of 2-(4-phenylphenyl)propanoic acid: 2-(para-biphenyl)propanoic acid, (RS)-2-(4'-biphenylyl)propanoic acid, 2-(4-Biphenylyl)-propionic acid, p-Phenylhydratropic Acid, 2-(p-Biphenyl)propionic acid, 2-(Biphenyl-4-yl)propanoic acid, Biprofen, Flurbiprofen Impurity 1. |
| Q: What is the boiling point of 2-(4-phenylphenyl)propanoic acid? |
| A: Boiling point of 2-(4-phenylphenyl)propanoic acid is 388.3ºC at 760 mmHg. |
| Q: What are the storage conditions for 2-(4-phenylphenyl)propanoic acid? |
| A: Storage conditions for 2-(4-phenylphenyl)propanoic acid: 2-8℃. |
| Q: What is the polar surface area (PSA) of 2-(4-phenylphenyl)propanoic acid? |
| A: Polar surface area (PSA) of 2-(4-phenylphenyl)propanoic acid is 37.30000. |
| Q: What is the English name of 2-(4-phenylphenyl)propanoic acid? |
| A: The English name of 2-(4-phenylphenyl)propanoic acid is 2-(4-phenylphenyl)propanoic acid. |
| Q: What is the InChIKey of 2-(4-phenylphenyl)propanoic acid? |
| A: InChIKey of 2-(4-phenylphenyl)propanoic acid is JALUUBQFLPUJMY-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2-(4-phenylphenyl)propanoic acid? |
| A: CAS number of 2-(4-phenylphenyl)propanoic acid is 6341-72-6. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |