2-Amino-5-(methoxycarbonyl)benzoic acid
2-Amino-5-(methoxycarbonyl)benzoic acid structure
|
Common Name | 2-Amino-5-(methoxycarbonyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 63746-25-8 | Molecular Weight | 195.172 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 424.5±35.0 °C at 760 mmHg | |
| Molecular Formula | C9H9NO4 | Melting Point | 224-225 °C(dec.) | |
| MSDS | N/A | Flash Point | 210.5±25.9 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-amino-5-methoxycarbonylbenzoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 424.5±35.0 °C at 760 mmHg |
| Melting Point | 224-225 °C(dec.) |
| Molecular Formula | C9H9NO4 |
| Molecular Weight | 195.172 |
| Flash Point | 210.5±25.9 °C |
| Exact Mass | 195.053162 |
| PSA | 89.62000 |
| LogP | 1.64 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.609 |
| InChIKey | XIGSLVIYSSSYNA-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(N)c(C(=O)O)c1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2922509090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 1 | |
CAS#:67-56-1
CAS#:201230-82-2
CAS#:5326-47-6
CAS#:76143-33-4
CAS#:4315-09-7
CAS#:89-87-2
CAS#:33890-03-8
CAS#:159847-80-0
CAS#:7501-68-0
CAS#:63746-12-3This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Amino-5-(methoxycarbonyl)benzoic acid |
| 2-amino-5-carbomethoxybenzoic acid |
| 4-Amino-isophthalsaeure-1-methylester |
| 2-Amino-5-(methoxycarbonyl)benzoicAcid |
| 4-amino-isophthalic acid-1-methyl ester |
| 1,3-Benzenedicarboxylic acid, 4-amino-, 1-methyl ester |
| 4-aminobenzene-1,3-dicarboxylic acid,1-methyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 2-amino-5-methoxycarbonylbenzoic acid? |
| A: Polar surface area (PSA) of 2-amino-5-methoxycarbonylbenzoic acid is 89.62000. |
| Q: What is the CAS number of 2-amino-5-methoxycarbonylbenzoic acid? |
| A: CAS number of 2-amino-5-methoxycarbonylbenzoic acid is 63746-25-8. |
| Q: What is the boiling point of 2-amino-5-methoxycarbonylbenzoic acid? |
| A: Boiling point of 2-amino-5-methoxycarbonylbenzoic acid is 424.5±35.0 °C at 760 mmHg. |
| Q: What are the upstream materials of 2-amino-5-methoxycarbonylbenzoic acid? |
| A: Related upstream materials(CAS) of 2-amino-5-methoxycarbonylbenzoic acid: 67-56-1;201230-82-2;5326-47-6;76143-33-4;4315-09-7;89-87-2;33890-03-8;159847-80-0;7501-68-0;63746-12-3. |
| Q: What is the SMILES notation of 2-amino-5-methoxycarbonylbenzoic acid? |
| A: SMILES notation of 2-amino-5-methoxycarbonylbenzoic acid is COC(=O)c1ccc(N)c(C(=O)O)c1. |
| Q: What is the InChIKey of 2-amino-5-methoxycarbonylbenzoic acid? |
| A: InChIKey of 2-amino-5-methoxycarbonylbenzoic acid is XIGSLVIYSSSYNA-UHFFFAOYSA-N. |
| Q: What is the LogP of 2-amino-5-methoxycarbonylbenzoic acid? |
| A: LogP of 2-amino-5-methoxycarbonylbenzoic acid is 1.64. |
| Q: What is the melting point of 2-amino-5-methoxycarbonylbenzoic acid? |
| A: Melting point of 2-amino-5-methoxycarbonylbenzoic acid is 224-225 °C(dec.). |
| Q: What is the molecular formula of 2-amino-5-methoxycarbonylbenzoic acid? |
| A: Molecular formula of 2-amino-5-methoxycarbonylbenzoic acid is C9H9NO4. |
| Q: What English synonyms does 2-amino-5-methoxycarbonylbenzoic acid have? |
| A: English synonyms of 2-amino-5-methoxycarbonylbenzoic acid: 2-Amino-5-(methoxycarbonyl)benzoic acid, 2-amino-5-carbomethoxybenzoic acid, 4-Amino-isophthalsaeure-1-methylester, 2-Amino-5-(methoxycarbonyl)benzoicAcid, 4-amino-isophthalic acid-1-methyl ester, 1,3-Benzenedicarboxylic acid, 4-amino-, 1-methyl ester, 4-aminobenzene-1,3-dicarboxylic acid,1-methyl ester. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |