1,2-Difluoro-4-methoxy-5-nitrobenzene
1,2-Difluoro-4-methoxy-5-nitrobenzene structure
|
Common Name | 1,2-Difluoro-4-methoxy-5-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 66684-64-8 | Molecular Weight | 189.116 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 264.7±35.0 °C at 760 mmHg | |
| Molecular Formula | C7H5F2NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 113.9±25.9 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,2-difluoro-4-methoxy-5-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 264.7±35.0 °C at 760 mmHg |
| Molecular Formula | C7H5F2NO3 |
| Molecular Weight | 189.116 |
| Flash Point | 113.9±25.9 °C |
| Exact Mass | 189.023743 |
| PSA | 55.05000 |
| LogP | 1.57 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.502 |
| InChIKey | JQFISHUXFQMRFG-UHFFFAOYSA-N |
| SMILES | COc1cc(F)c(F)cc1[N+](=O)[O-] |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2909309090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~85%
1,2-Difluoro-4-... CAS#:66684-64-8 |
| Literature: ASTRAZENECA AB Patent: US2012/28924 A1, 2012 ; Location in patent: Page/Page column 35 ; US 20120028924 A1 |
|
~%
1,2-Difluoro-4-... CAS#:66684-64-8 |
| Literature: US2012/28924 A1, ; US 20120028924 A1 |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4,5-Difluoro-2-nitrophenyl methyl ether |
| 1,2-Difluoro-4-methoxy-5-nitrobenzene |
| 4,5-DIFLUORO-2-NITROANISOLE |
| 3,4-difluoro-6-nitroanisole |
| 4,5-Difluor-2-methoxynitrobenzol |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1,2-difluoro-4-methoxy-5-nitrobenzene? |
| A: The English name of 1,2-difluoro-4-methoxy-5-nitrobenzene is 1,2-difluoro-4-methoxy-5-nitrobenzene. |
| Q: What is the SMILES notation of 1,2-difluoro-4-methoxy-5-nitrobenzene? |
| A: SMILES notation of 1,2-difluoro-4-methoxy-5-nitrobenzene is COc1cc(F)c(F)cc1[N+](=O)[O-]. |
| Q: What is the boiling point of 1,2-difluoro-4-methoxy-5-nitrobenzene? |
| A: Boiling point of 1,2-difluoro-4-methoxy-5-nitrobenzene is 264.7±35.0 °C at 760 mmHg. |
| Q: What English synonyms does 1,2-difluoro-4-methoxy-5-nitrobenzene have? |
| A: English synonyms of 1,2-difluoro-4-methoxy-5-nitrobenzene: 4,5-Difluoro-2-nitrophenyl methyl ether, 1,2-Difluoro-4-methoxy-5-nitrobenzene, 4,5-DIFLUORO-2-NITROANISOLE, 3,4-difluoro-6-nitroanisole, 4,5-Difluor-2-methoxynitrobenzol. |
| Q: What is the molecular weight of 1,2-difluoro-4-methoxy-5-nitrobenzene? |
| A: Molecular weight of 1,2-difluoro-4-methoxy-5-nitrobenzene is 189.116. |
| Q: What is the polar surface area (PSA) of 1,2-difluoro-4-methoxy-5-nitrobenzene? |
| A: Polar surface area (PSA) of 1,2-difluoro-4-methoxy-5-nitrobenzene is 55.05000. |
| Q: What is the LogP of 1,2-difluoro-4-methoxy-5-nitrobenzene? |
| A: LogP of 1,2-difluoro-4-methoxy-5-nitrobenzene is 1.57. |
| Q: What is the InChIKey of 1,2-difluoro-4-methoxy-5-nitrobenzene? |
| A: InChIKey of 1,2-difluoro-4-methoxy-5-nitrobenzene is JQFISHUXFQMRFG-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1,2-difluoro-4-methoxy-5-nitrobenzene? |
| A: CAS number of 1,2-difluoro-4-methoxy-5-nitrobenzene is 66684-64-8. |
| Q: What is the molecular formula of 1,2-difluoro-4-methoxy-5-nitrobenzene? |
| A: Molecular formula of 1,2-difluoro-4-methoxy-5-nitrobenzene is C7H5F2NO3. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |