2,4,6-trip-tolyl-1,3,5-triazine
2,4,6-trip-tolyl-1,3,5-triazine structure
|
Common Name | 2,4,6-trip-tolyl-1,3,5-triazine | ||
|---|---|---|---|---|
| CAS Number | 6726-45-0 | Molecular Weight | 351.44400 | |
| Density | 1.12g/cm3 | Boiling Point | 561.5ºC at 760 mmHg | |
| Molecular Formula | C24H21N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246.9ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,4,6-tris(4-methylphenyl)-1,3,5-triazine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 561.5ºC at 760 mmHg |
| Molecular Formula | C24H21N3 |
| Molecular Weight | 351.44400 |
| Flash Point | 246.9ºC |
| Exact Mass | 351.17400 |
| PSA | 38.67000 |
| LogP | 5.79780 |
| Index of Refraction | 1.609 |
| InChIKey | FLJCTCVDRKPLHJ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-c2nc(-c3ccc(C)cc3)nc(-c3ccc(C)cc3)n2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 3 | |
CAS#:104-85-8
CAS#:104-87-0
CAS#:142312-17-2
CAS#:4294-57-9![N,N'-bis[4-methylbenzylidene]-4-methylphenylmethanediamine Structure](https://image.chemsrc.com/caspic/317/35779-32-9.png)
CAS#:35779-32-9
CAS#:108-77-0
CAS#:108-88-3
CAS#:56108-06-6
CAS#:14921-00-7
CAS#:506-68-3
CAS#:61414-16-2
CAS#:99-94-5
CAS#:100-21-0This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4,4',4''-s-triazine-2,4,6-tri-p-tolyl |
| 2,4,6-tri-p-tolyl-s-triazine |
| 2,4,6-TRI-TOLYL-1,3,5-TRIAZINE |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2,4,6-tris(4-methylphenyl)-1,3,5-triazine? |
| A: InChIKey of 2,4,6-tris(4-methylphenyl)-1,3,5-triazine is FLJCTCVDRKPLHJ-UHFFFAOYSA-N. |
| Q: What are the downstream products of 2,4,6-tris(4-methylphenyl)-1,3,5-triazine? |
| A: Related downstream products(CAS) of 2,4,6-tris(4-methylphenyl)-1,3,5-triazine: 61414-16-2;99-94-5;100-21-0. |
| Q: What is the English name of 2,4,6-tris(4-methylphenyl)-1,3,5-triazine? |
| A: The English name of 2,4,6-tris(4-methylphenyl)-1,3,5-triazine is 2,4,6-tris(4-methylphenyl)-1,3,5-triazine. |
| Q: What is the CAS number of 2,4,6-tris(4-methylphenyl)-1,3,5-triazine? |
| A: CAS number of 2,4,6-tris(4-methylphenyl)-1,3,5-triazine is 6726-45-0. |
| Q: What is the molecular formula of 2,4,6-tris(4-methylphenyl)-1,3,5-triazine? |
| A: Molecular formula of 2,4,6-tris(4-methylphenyl)-1,3,5-triazine is C24H21N3. |
| Q: What English synonyms does 2,4,6-tris(4-methylphenyl)-1,3,5-triazine have? |
| A: English synonyms of 2,4,6-tris(4-methylphenyl)-1,3,5-triazine: 4,4',4''-s-triazine-2,4,6-tri-p-tolyl, 2,4,6-tri-p-tolyl-s-triazine, 2,4,6-TRI-TOLYL-1,3,5-TRIAZINE. |
| Q: What are the upstream materials of 2,4,6-tris(4-methylphenyl)-1,3,5-triazine? |
| A: Related upstream materials(CAS) of 2,4,6-tris(4-methylphenyl)-1,3,5-triazine: 104-85-8;104-87-0;142312-17-2;4294-57-9;35779-32-9;108-77-0;108-88-3;56108-06-6;14921-00-7;506-68-3. |
| Q: What is the polar surface area (PSA) of 2,4,6-tris(4-methylphenyl)-1,3,5-triazine? |
| A: Polar surface area (PSA) of 2,4,6-tris(4-methylphenyl)-1,3,5-triazine is 38.67000. |
| Q: What is the boiling point of 2,4,6-tris(4-methylphenyl)-1,3,5-triazine? |
| A: Boiling point of 2,4,6-tris(4-methylphenyl)-1,3,5-triazine is 561.5ºC at 760 mmHg. |
| Q: What is the LogP of 2,4,6-tris(4-methylphenyl)-1,3,5-triazine? |
| A: LogP of 2,4,6-tris(4-methylphenyl)-1,3,5-triazine is 5.79780. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |