4-methoxyphenyl trans-4-pentylcyclohexanoate
4-methoxyphenyl trans-4-pentylcyclohexanoate structure
|
Common Name | 4-methoxyphenyl trans-4-pentylcyclohexanoate | ||
|---|---|---|---|---|
| CAS Number | 67589-52-0 | Molecular Weight | 304.42400 | |
| Density | 1.012g/cm3 | Boiling Point | 409.7ºC at 760 mmHg | |
| Molecular Formula | C19H28O3 | Melting Point | 40℃ | |
| MSDS | N/A | Flash Point | 173.7ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (4-methoxyphenyl) 4-pentylcyclohexane-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.012g/cm3 |
|---|---|
| Boiling Point | 409.7ºC at 760 mmHg |
| Melting Point | 40℃ |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.42400 |
| Flash Point | 173.7ºC |
| Exact Mass | 304.20400 |
| PSA | 35.53000 |
| LogP | 4.98730 |
| Index of Refraction | 1.499 |
| InChIKey | HJIVFZUPTYADSP-UHFFFAOYSA-N |
| SMILES | CCCCCC1CCC(C(=O)Oc2ccc(OC)cc2)CC1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2916209090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
4-methoxyphenyl... CAS#:67589-52-0 |
| Literature: Journal fuer Praktische Chemie (Leipzig), , vol. 320, p. 191 - 205 |
|
~%
4-methoxyphenyl... CAS#:67589-52-0 |
| Literature: Journal fuer Praktische Chemie (Leipzig), , vol. 320, p. 191 - 205 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2916209090 |
|---|---|
| Summary | 2916209090 other cyclanic, cyclenic or cyclotherpenic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-methoxyphenyl 4-trans-pentylcyclohexanecarboxylate |
| TRANS-4-PENTYL-CYCLOHEXANECARBOXYLIC ACID 4-METHOXY-PHENYL ESTER |
| trans-4-pentylcyclohexanecarboxylic acid p-methoxyphenyl ester |
| p-methoxyphenyl trans-4-pentyl cyclohexane carboxylate |
| 4-METHOXYPHENYL TRANS-4-PENTYLCYCLOHEXANECARBOXYLATE |
| 4-Methoxyphenyl 4-pentylcyclohexanecarboxylate |
| p-methoxyphenyl trans-4-n-pentylcyclohexanecarboxylate |
| Cyclohexanecarboxylic acid,4-pentyl-,4-methoxyphenyl ester,trans |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of (4-methoxyphenyl) 4-pentylcyclohexane-1-carboxylate? |
| A: SMILES notation of (4-methoxyphenyl) 4-pentylcyclohexane-1-carboxylate is CCCCCC1CCC(C(=O)Oc2ccc(OC)cc2)CC1. |
| Q: What is the English name of (4-methoxyphenyl) 4-pentylcyclohexane-1-carboxylate? |
| A: The English name of (4-methoxyphenyl) 4-pentylcyclohexane-1-carboxylate is (4-methoxyphenyl) 4-pentylcyclohexane-1-carboxylate. |
| Q: What are the upstream materials of (4-methoxyphenyl) 4-pentylcyclohexane-1-carboxylate? |
| A: Related upstream materials(CAS) of (4-methoxyphenyl) 4-pentylcyclohexane-1-carboxylate: 26311-45-5;67589-90-6;150-76-5. |
| Q: What is the InChIKey of (4-methoxyphenyl) 4-pentylcyclohexane-1-carboxylate? |
| A: InChIKey of (4-methoxyphenyl) 4-pentylcyclohexane-1-carboxylate is HJIVFZUPTYADSP-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of (4-methoxyphenyl) 4-pentylcyclohexane-1-carboxylate? |
| A: Polar surface area (PSA) of (4-methoxyphenyl) 4-pentylcyclohexane-1-carboxylate is 35.53000. |
| Q: What is the CAS number of (4-methoxyphenyl) 4-pentylcyclohexane-1-carboxylate? |
| A: CAS number of (4-methoxyphenyl) 4-pentylcyclohexane-1-carboxylate is 67589-52-0. |
| Q: What is the molecular weight of (4-methoxyphenyl) 4-pentylcyclohexane-1-carboxylate? |
| A: Molecular weight of (4-methoxyphenyl) 4-pentylcyclohexane-1-carboxylate is 304.42400. |
| Q: What is the molecular formula of (4-methoxyphenyl) 4-pentylcyclohexane-1-carboxylate? |
| A: Molecular formula of (4-methoxyphenyl) 4-pentylcyclohexane-1-carboxylate is C19H28O3. |
| Q: What is the LogP of (4-methoxyphenyl) 4-pentylcyclohexane-1-carboxylate? |
| A: LogP of (4-methoxyphenyl) 4-pentylcyclohexane-1-carboxylate is 4.98730. |
| Q: What is the melting point of (4-methoxyphenyl) 4-pentylcyclohexane-1-carboxylate? |
| A: Melting point of (4-methoxyphenyl) 4-pentylcyclohexane-1-carboxylate is 40℃. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |