N'-Phenyl-3-(2-phenylhydrazono)butanehydrazide
N'-Phenyl-3-(2-phenylhydrazono)butanehydrazide structure
|
Common Name | N'-Phenyl-3-(2-phenylhydrazono)butanehydrazide | ||
|---|---|---|---|---|
| CAS Number | 67790-05-0 | Molecular Weight | 282.34 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H18N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,5-dichloro-1,5-dimethyl-1,3,3,5-tetraphenyltrisiloxane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H18N4O |
|---|---|
| Molecular Weight | 282.34 |
| Exact Mass | 282.14806121 |
| PSA | 18.46000 |
| LogP | 4.71220 |
| InChIKey | QTLGWFRBRJWQGK-GHRIWEEISA-N |
| SMILES | C/C(=NNC1=CC=CC=C1)/CC(=O)NNC2=CC=CC=C2 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:19735-89-8This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 1,5-dichloro-1,5-dimethyl-1,3,3,5-tetraphenyltrisiloxane? |
| A: SMILES notation of 1,5-dichloro-1,5-dimethyl-1,3,3,5-tetraphenyltrisiloxane is C/C(=NNC1=CC=CC=C1)/CC(=O)NNC2=CC=CC=C2. |
| Q: What is the CAS number of 1,5-dichloro-1,5-dimethyl-1,3,3,5-tetraphenyltrisiloxane? |
| A: CAS number of 1,5-dichloro-1,5-dimethyl-1,3,3,5-tetraphenyltrisiloxane is 67790-05-0. |
| Q: What is the LogP of 1,5-dichloro-1,5-dimethyl-1,3,3,5-tetraphenyltrisiloxane? |
| A: LogP of 1,5-dichloro-1,5-dimethyl-1,3,3,5-tetraphenyltrisiloxane is 4.71220. |
| Q: What is the molecular formula of 1,5-dichloro-1,5-dimethyl-1,3,3,5-tetraphenyltrisiloxane? |
| A: Molecular formula of 1,5-dichloro-1,5-dimethyl-1,3,3,5-tetraphenyltrisiloxane is C16H18N4O. |
| Q: What is the molecular weight of 1,5-dichloro-1,5-dimethyl-1,3,3,5-tetraphenyltrisiloxane? |
| A: Molecular weight of 1,5-dichloro-1,5-dimethyl-1,3,3,5-tetraphenyltrisiloxane is 282.34. |
| Q: What is the polar surface area (PSA) of 1,5-dichloro-1,5-dimethyl-1,3,3,5-tetraphenyltrisiloxane? |
| A: Polar surface area (PSA) of 1,5-dichloro-1,5-dimethyl-1,3,3,5-tetraphenyltrisiloxane is 18.46000. |
| Q: What is the English name of 1,5-dichloro-1,5-dimethyl-1,3,3,5-tetraphenyltrisiloxane? |
| A: The English name of 1,5-dichloro-1,5-dimethyl-1,3,3,5-tetraphenyltrisiloxane is 1,5-dichloro-1,5-dimethyl-1,3,3,5-tetraphenyltrisiloxane. |
| Q: What are the downstream products of 1,5-dichloro-1,5-dimethyl-1,3,3,5-tetraphenyltrisiloxane? |
| A: Related downstream products(CAS) of 1,5-dichloro-1,5-dimethyl-1,3,3,5-tetraphenyltrisiloxane: 19735-89-8. |
| Q: What is the InChIKey of 1,5-dichloro-1,5-dimethyl-1,3,3,5-tetraphenyltrisiloxane? |
| A: InChIKey of 1,5-dichloro-1,5-dimethyl-1,3,3,5-tetraphenyltrisiloxane is QTLGWFRBRJWQGK-GHRIWEEISA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |