5-Bromo-4-methoxy-2-nitroaniline
Modify Date: 2026-06-30 15:50:35
5-Bromo-4-methoxy-2-nitroaniline structure
|
Common Name | 5-Bromo-4-methoxy-2-nitroaniline | ||
|---|---|---|---|---|
| CAS Number | 6943-69-7 | Molecular Weight | 247.05 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 359.6±21.0 °C at 760 mmHg | |
| Molecular Formula | C7H7BrN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 143.6±11.3 °C | |
| Name | 5-Bromo-4-methoxy-2-nitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 359.6±21.0 °C at 760 mmHg |
| Molecular Formula | C7H7BrN2O3 |
| Molecular Weight | 247.05 |
| Flash Point | 143.6±11.3 °C |
| Exact Mass | 245.96400 |
| PSA | 81.07000 |
| LogP | 5.63 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.541 |
| InChIKey | HQUCUBOXGLEYNA-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)[N+](=O)[O-])N)Br |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
Total 2, Current Page 1 of 1
1
| 1-(Allyloxy)-4-(2-phenylpropan-2-yl)benzene |
| allyl p-cumylphenyl ether |
| 1-(Allyloxy)-4-(2-phenyl-2-propanyl)benzene |
| 5-bromo-4-methoxy-2-nitroaniline |
| Allyl 4-(2-phenylpropan-2-yl)phenyl ether |