4-Keto 13-cis-Retinoic Acid Methyl Ester
4-Keto 13-cis-Retinoic Acid Methyl Ester structure
|
Common Name | 4-Keto 13-cis-Retinoic Acid Methyl Ester | ||
|---|---|---|---|---|
| CAS Number | 71748-57-7 | Molecular Weight | 328.44500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H28O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 4-Keto 13-cis-Retinoic Acid Methyl EsterMethyl 13-cis-4-Oxoretinoate is a bioactive chemical. |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl (2Z,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)nona-2,4,6,8-tetraenoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H28O3 |
|---|---|
| Molecular Weight | 328.44500 |
| Exact Mass | 328.20400 |
| PSA | 43.37000 |
| LogP | 4.87000 |
| InChIKey | VTSFDGSDUILKPM-ZTXQEUQPSA-N |
| SMILES | COC(=O)C=C(C)C=CC=C(C)C=CC1=C(C)C(=O)CCC1(C)C |
| Storage condition | -20℃ |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:38030-57-8This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-Keto 13-cis-Retinoic Acid Methyl Ester |
| 4-Oxo-retinoic acid methyl ester |
| Methyl 13-cis-4-Oxoretinoate |
| Methyl-4-oxo-retinoat |
| methyl 4-oxo-retinoate |
| Methyl-all-trans-4-oxo-retinoat |
| 4-oxo-(E)-methylretinoate |
| 13-cis-4-Oxo-retinoic acid Methyl Ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does methyl (2Z,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)nona-2,4,6,8-tetraenoate have? |
| A: English synonyms of methyl (2Z,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)nona-2,4,6,8-tetraenoate: 4-Keto 13-cis-Retinoic Acid Methyl Ester, 4-Oxo-retinoic acid methyl ester, Methyl 13-cis-4-Oxoretinoate, Methyl-4-oxo-retinoat, methyl 4-oxo-retinoate, Methyl-all-trans-4-oxo-retinoat, 4-oxo-(E)-methylretinoate, 13-cis-4-Oxo-retinoic acid Methyl Ester. |
| Q: What is the SMILES notation of methyl (2Z,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)nona-2,4,6,8-tetraenoate? |
| A: SMILES notation of methyl (2Z,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)nona-2,4,6,8-tetraenoate is COC(=O)C=C(C)C=CC=C(C)C=CC1=C(C)C(=O)CCC1(C)C. |
| Q: What are the storage conditions for methyl (2Z,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)nona-2,4,6,8-tetraenoate? |
| A: Storage conditions for methyl (2Z,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)nona-2,4,6,8-tetraenoate: -20℃. |
| Q: What is the English name of methyl (2Z,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)nona-2,4,6,8-tetraenoate? |
| A: The English name of methyl (2Z,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)nona-2,4,6,8-tetraenoate is methyl (2Z,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)nona-2,4,6,8-tetraenoate. |
| Q: What is the molecular formula of methyl (2Z,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)nona-2,4,6,8-tetraenoate? |
| A: Molecular formula of methyl (2Z,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)nona-2,4,6,8-tetraenoate is C21H28O3. |
| Q: What are the uses of methyl (2Z,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)nona-2,4,6,8-tetraenoate? |
| A: Main uses of methyl (2Z,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)nona-2,4,6,8-tetraenoate: Methyl 13-cis-4-Oxoretinoate is a bioactive chemical. |
| Q: What is the InChIKey of methyl (2Z,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)nona-2,4,6,8-tetraenoate? |
| A: InChIKey of methyl (2Z,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)nona-2,4,6,8-tetraenoate is VTSFDGSDUILKPM-ZTXQEUQPSA-N. |
| Q: What is the molecular weight of methyl (2Z,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)nona-2,4,6,8-tetraenoate? |
| A: Molecular weight of methyl (2Z,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)nona-2,4,6,8-tetraenoate is 328.44500. |
| Q: What is the CAS number of methyl (2Z,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)nona-2,4,6,8-tetraenoate? |
| A: CAS number of methyl (2Z,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)nona-2,4,6,8-tetraenoate is 71748-57-7. |
| Q: What is the LogP of methyl (2Z,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)nona-2,4,6,8-tetraenoate? |
| A: LogP of methyl (2Z,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)nona-2,4,6,8-tetraenoate is 4.87000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |