4'-methyl-2,2':6',2''-terpyridine
4'-methyl-2,2':6',2''-terpyridine structure
|
Common Name | 4'-methyl-2,2':6',2''-terpyridine | ||
|---|---|---|---|---|
| CAS Number | 72036-41-0 | Molecular Weight | 247.29500 | |
| Density | 1.145g/cm3 | Boiling Point | 401.464ºC at 760 mmHg | |
| Molecular Formula | C16H13N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 178.511ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4'-methyl-2,2':6',2''-terpyridine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.145g/cm3 |
|---|---|
| Boiling Point | 401.464ºC at 760 mmHg |
| Molecular Formula | C16H13N3 |
| Molecular Weight | 247.29500 |
| Flash Point | 178.511ºC |
| Exact Mass | 247.11100 |
| PSA | 38.67000 |
| LogP | 3.51400 |
| Index of Refraction | 1.607 |
| InChIKey | UZUDKOHDONKQCH-UHFFFAOYSA-N |
| SMILES | Cc1cc(-c2ccccn2)nc(-c2ccccn2)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-methyl-benzo[1,2,5]thiadiazole |
| 2,6-di-(2-pyridyl)-4-methylpyridine |
| 4-methylbenzo[c][1,2,5]thiadiazole |
| 4'-methyl-2,2',6',2''-terpyridine |
| 4-Methyl-benz-<2,1,3>-thiadiazol |
| 4'-methylterpyridine |
| 4-Methylbenzo-2,1,3-thiadiazole |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 4'-methyl-2,2':6',2''-terpyridine? |
| A: Molecular weight of 4'-methyl-2,2':6',2''-terpyridine is 247.29500. |
| Q: What is the molecular formula of 4'-methyl-2,2':6',2''-terpyridine? |
| A: Molecular formula of 4'-methyl-2,2':6',2''-terpyridine is C16H13N3. |
| Q: What English synonyms does 4'-methyl-2,2':6',2''-terpyridine have? |
| A: English synonyms of 4'-methyl-2,2':6',2''-terpyridine: 4-methyl-benzo[1,2,5]thiadiazole, 2,6-di-(2-pyridyl)-4-methylpyridine, 4-methylbenzo[c][1,2,5]thiadiazole, 4'-methyl-2,2',6',2''-terpyridine, 4-Methyl-benz--thiadiazol, 4'-methylterpyridine, 4-Methylbenzo-2,1,3-thiadiazole. |
| Q: What is the SMILES notation of 4'-methyl-2,2':6',2''-terpyridine? |
| A: SMILES notation of 4'-methyl-2,2':6',2''-terpyridine is Cc1cc(-c2ccccn2)nc(-c2ccccn2)c1. |
| Q: What is the CAS number of 4'-methyl-2,2':6',2''-terpyridine? |
| A: CAS number of 4'-methyl-2,2':6',2''-terpyridine is 72036-41-0. |
| Q: What is the English name of 4'-methyl-2,2':6',2''-terpyridine? |
| A: The English name of 4'-methyl-2,2':6',2''-terpyridine is 4'-methyl-2,2':6',2''-terpyridine. |
| Q: What is the boiling point of 4'-methyl-2,2':6',2''-terpyridine? |
| A: Boiling point of 4'-methyl-2,2':6',2''-terpyridine is 401.464ºC at 760 mmHg. |
| Q: What is the polar surface area (PSA) of 4'-methyl-2,2':6',2''-terpyridine? |
| A: Polar surface area (PSA) of 4'-methyl-2,2':6',2''-terpyridine is 38.67000. |
| Q: What is the LogP of 4'-methyl-2,2':6',2''-terpyridine? |
| A: LogP of 4'-methyl-2,2':6',2''-terpyridine is 3.51400. |
| Q: What is the InChIKey of 4'-methyl-2,2':6',2''-terpyridine? |
| A: InChIKey of 4'-methyl-2,2':6',2''-terpyridine is UZUDKOHDONKQCH-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |