1-Iodo-3-methoxy-2-nitrobenzene, 3-Iodo-2-nitrophenyl methyl ether
1-Iodo-3-methoxy-2-nitrobenzene, 3-Iodo-2-nitrophenyl methyl ether structure
|
Common Name | 1-Iodo-3-methoxy-2-nitrobenzene, 3-Iodo-2-nitrophenyl methyl ether | ||
|---|---|---|---|---|
| CAS Number | 725266-66-0 | Molecular Weight | 279.03200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H6INO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-iodo-3-methoxy-2-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H6INO3 |
|---|---|
| Molecular Weight | 279.03200 |
| Exact Mass | 278.93900 |
| PSA | 55.05000 |
| LogP | 2.73120 |
| InChIKey | RINUUFLGNUBQLM-UHFFFAOYSA-N |
| SMILES | COc1cccc(I)c1[N+](=O)[O-] |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:142596-50-7This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Methyl-(3-jod-2-nitro-phenyl)-aether |
| 3-iodo-2-nitro-anisole |
| 1-Iod-3-methoxy-2-nitro-benzol |
| 3-Jod-2-nitro-1-methoxy-benzol |
| 3-IODO-2-NITROANISOLE |
| 3-Jod-2-nitro-anisol |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of 1-iodo-3-methoxy-2-nitrobenzene? |
| A: Related downstream products(CAS) of 1-iodo-3-methoxy-2-nitrobenzene: 142596-50-7. |
| Q: What is the polar surface area (PSA) of 1-iodo-3-methoxy-2-nitrobenzene? |
| A: Polar surface area (PSA) of 1-iodo-3-methoxy-2-nitrobenzene is 55.05000. |
| Q: What is the InChIKey of 1-iodo-3-methoxy-2-nitrobenzene? |
| A: InChIKey of 1-iodo-3-methoxy-2-nitrobenzene is RINUUFLGNUBQLM-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1-iodo-3-methoxy-2-nitrobenzene? |
| A: CAS number of 1-iodo-3-methoxy-2-nitrobenzene is 725266-66-0. |
| Q: What is the molecular weight of 1-iodo-3-methoxy-2-nitrobenzene? |
| A: Molecular weight of 1-iodo-3-methoxy-2-nitrobenzene is 279.03200. |
| Q: What is the SMILES notation of 1-iodo-3-methoxy-2-nitrobenzene? |
| A: SMILES notation of 1-iodo-3-methoxy-2-nitrobenzene is COc1cccc(I)c1[N+](=O)[O-]. |
| Q: What is the molecular formula of 1-iodo-3-methoxy-2-nitrobenzene? |
| A: Molecular formula of 1-iodo-3-methoxy-2-nitrobenzene is C7H6INO3. |
| Q: What English synonyms does 1-iodo-3-methoxy-2-nitrobenzene have? |
| A: English synonyms of 1-iodo-3-methoxy-2-nitrobenzene: Methyl-(3-jod-2-nitro-phenyl)-aether, 3-iodo-2-nitro-anisole, 1-Iod-3-methoxy-2-nitro-benzol, 3-Jod-2-nitro-1-methoxy-benzol, 3-IODO-2-NITROANISOLE, 3-Jod-2-nitro-anisol. |
| Q: What is the LogP of 1-iodo-3-methoxy-2-nitrobenzene? |
| A: LogP of 1-iodo-3-methoxy-2-nitrobenzene is 2.73120. |
| Q: What is the English name of 1-iodo-3-methoxy-2-nitrobenzene? |
| A: The English name of 1-iodo-3-methoxy-2-nitrobenzene is 1-iodo-3-methoxy-2-nitrobenzene. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |