Ethyl 1-acetyl-4-oxocyclohexanecarboxylate
Ethyl 1-acetyl-4-oxocyclohexanecarboxylate structure
|
Common Name | Ethyl 1-acetyl-4-oxocyclohexanecarboxylate | ||
|---|---|---|---|---|
| CAS Number | 72653-21-5 | Molecular Weight | 212.24200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: Ethyl 1-acetyl-4-oxocyclohexanecarboxylate (CAS number: 72653-21-5, molecular formula: C11H16O4, molecular weight: 212.24200), for research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 1-acetyl-4-oxocyclohexane-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H16O4 |
|---|---|
| Molecular Weight | 212.24200 |
| Exact Mass | 212.10500 |
| PSA | 60.44000 |
| LogP | 1.26800 |
| InChIKey | CBUZTWMDYDHENI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(C(C)=O)CCC(=O)CC1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 5 | |
CAS#:17159-79-4![Bicyclo[2.2.2]octane, 1,4-difluoro structure](https://image.chemsrc.com/caspic/225/20277-40-1.png)
CAS#:20277-40-1![Methyl 4-Hydroxybicyclo[2.2.2]octane-1-carboxylate structure](https://image.chemsrc.com/caspic/296/23062-53-5.png)
CAS#:23062-53-5![4-methoxybicyclo[2.2.2]octane-1-carboxylic acid structure](https://image.chemsrc.com/caspic/220/773-34-2.png)
CAS#:773-34-2![Bicyclo[2.2.2]octane-1-carbonyl chloride, 4-fluoro- (9CI) structure](https://image.chemsrc.com/caspic/024/81687-78-7.png)
CAS#:81687-78-7This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-acetyl-4-ethoxyformylcyclohexanone |
| 1-acetyl-4-oxocyclohexyl carboxylic acid ethyl ester |
| ethyl 1-acetyl-4-oxocyclohexanecarboxylate |
| 1-Acetyl-4-oxo-cyclohexancarbonsaeureaethylester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of ethyl 1-acetyl-4-oxocyclohexane-1-carboxylate? |
| A: SMILES notation of ethyl 1-acetyl-4-oxocyclohexane-1-carboxylate is CCOC(=O)C1(C(C)=O)CCC(=O)CC1. |
| Q: What English synonyms does ethyl 1-acetyl-4-oxocyclohexane-1-carboxylate have? |
| A: English synonyms of ethyl 1-acetyl-4-oxocyclohexane-1-carboxylate: 4-acetyl-4-ethoxyformylcyclohexanone, 1-acetyl-4-oxocyclohexyl carboxylic acid ethyl ester, ethyl 1-acetyl-4-oxocyclohexanecarboxylate, 1-Acetyl-4-oxo-cyclohexancarbonsaeureaethylester. |
| Q: What is the LogP of ethyl 1-acetyl-4-oxocyclohexane-1-carboxylate? |
| A: LogP of ethyl 1-acetyl-4-oxocyclohexane-1-carboxylate is 1.26800. |
| Q: What is the InChIKey of ethyl 1-acetyl-4-oxocyclohexane-1-carboxylate? |
| A: InChIKey of ethyl 1-acetyl-4-oxocyclohexane-1-carboxylate is CBUZTWMDYDHENI-UHFFFAOYSA-N. |
| Q: What is the CAS number of ethyl 1-acetyl-4-oxocyclohexane-1-carboxylate? |
| A: CAS number of ethyl 1-acetyl-4-oxocyclohexane-1-carboxylate is 72653-21-5. |
| Q: What is the molecular weight of ethyl 1-acetyl-4-oxocyclohexane-1-carboxylate? |
| A: Molecular weight of ethyl 1-acetyl-4-oxocyclohexane-1-carboxylate is 212.24200. |
| Q: What is the molecular formula of ethyl 1-acetyl-4-oxocyclohexane-1-carboxylate? |
| A: Molecular formula of ethyl 1-acetyl-4-oxocyclohexane-1-carboxylate is C11H16O4. |
| Q: What is the polar surface area (PSA) of ethyl 1-acetyl-4-oxocyclohexane-1-carboxylate? |
| A: Polar surface area (PSA) of ethyl 1-acetyl-4-oxocyclohexane-1-carboxylate is 60.44000. |
| Q: What are the downstream products of ethyl 1-acetyl-4-oxocyclohexane-1-carboxylate? |
| A: Related downstream products(CAS) of ethyl 1-acetyl-4-oxocyclohexane-1-carboxylate: 17159-79-4;20277-40-1;23062-53-5;773-34-2;81687-78-7. |
| Q: What is the English name of ethyl 1-acetyl-4-oxocyclohexane-1-carboxylate? |
| A: The English name of ethyl 1-acetyl-4-oxocyclohexane-1-carboxylate is ethyl 1-acetyl-4-oxocyclohexane-1-carboxylate. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |