2-piperazin-1-yl-5-(trifluoromethyl)pyrimidine
2-piperazin-1-yl-5-(trifluoromethyl)pyrimidine structure
|
Common Name | 2-piperazin-1-yl-5-(trifluoromethyl)pyrimidine | ||
|---|---|---|---|---|
| CAS Number | 745066-18-6 | Molecular Weight | 232.20600 | |
| Density | 1.307 g/cm3 | Boiling Point | 331.282ºC at 760 mmHg | |
| Molecular Formula | C9H11F3N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 154.154ºC | |
Summary: 2-piperazin-1-yl-5-(trifluoromethyl)pyrimidine (CAS: 745066-18-6, molecular formula: C9H11F3N4, molecular weight: 232.20600) For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-piperazin-1-yl-5-(trifluoromethyl)pyrimidine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.307 g/cm3 |
|---|---|
| Boiling Point | 331.282ºC at 760 mmHg |
| Molecular Formula | C9H11F3N4 |
| Molecular Weight | 232.20600 |
| Flash Point | 154.154ºC |
| Exact Mass | 232.09400 |
| PSA | 41.05000 |
| LogP | 1.29880 |
| InChIKey | AJPNCKCRSAVLLC-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1cnc(N2CCNCC2)nc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~91%
2-piperazin-1-y... CAS#:745066-18-6 |
| Literature: Pinard, Emmanuel; Alanine, Alexander; Alberati, Daniela; Bender, Markus; Borroni, Edilio; Bourdeaux, Patrick; Brom, Virginie; Burner, Serge; Fischer, Holger; Hainzl, Dominik; Halm, Remy; Hauser, Nicole; Jolidon, Synese; Lengyel, Judith; Marty, Hans-Peter; Meyer, Thierry; Moreau, Jean-Luc; Mory, Roland; Narquizian, Robert; Nettekoven, Mathias; Norcross, Roger D.; Puellmann, Bernd; Schmid, Philipp; Schmitt, Sebastien; Stalder, Henri; Wermuth, Roger; Wettstein, Joseph G.; Zimmerli, Daniel Journal of Medicinal Chemistry, 2010 , vol. 53, # 12 p. 4603 - 4614 |
|
~%
2-piperazin-1-y... CAS#:745066-18-6 |
| Literature: PFIZER LIMITED; PFIZER INC. Patent: WO2004/72086 A2, 2004 ; Location in patent: Page 207 ; |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| PYRIMIDINE,2-(1-PIPERAZINYL)-5-(TRIFLUOROMETHYL) |
| 2-piperazin-1-yl-5-trifluoromethyl-pyrimidine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2-piperazin-1-yl-5-(trifluoromethyl)pyrimidine? |
| A: The English name of 2-piperazin-1-yl-5-(trifluoromethyl)pyrimidine is 2-piperazin-1-yl-5-(trifluoromethyl)pyrimidine. |
| Q: What is the molecular formula of 2-piperazin-1-yl-5-(trifluoromethyl)pyrimidine? |
| A: Molecular formula of 2-piperazin-1-yl-5-(trifluoromethyl)pyrimidine is C9H11F3N4. |
| Q: What is the boiling point of 2-piperazin-1-yl-5-(trifluoromethyl)pyrimidine? |
| A: Boiling point of 2-piperazin-1-yl-5-(trifluoromethyl)pyrimidine is 331.282ºC at 760 mmHg. |
| Q: What is the SMILES notation of 2-piperazin-1-yl-5-(trifluoromethyl)pyrimidine? |
| A: SMILES notation of 2-piperazin-1-yl-5-(trifluoromethyl)pyrimidine is FC(F)(F)c1cnc(N2CCNCC2)nc1. |
| Q: What is the LogP of 2-piperazin-1-yl-5-(trifluoromethyl)pyrimidine? |
| A: LogP of 2-piperazin-1-yl-5-(trifluoromethyl)pyrimidine is 1.29880. |
| Q: What is the molecular weight of 2-piperazin-1-yl-5-(trifluoromethyl)pyrimidine? |
| A: Molecular weight of 2-piperazin-1-yl-5-(trifluoromethyl)pyrimidine is 232.20600. |
| Q: What is the polar surface area (PSA) of 2-piperazin-1-yl-5-(trifluoromethyl)pyrimidine? |
| A: Polar surface area (PSA) of 2-piperazin-1-yl-5-(trifluoromethyl)pyrimidine is 41.05000. |
| Q: What is the InChIKey of 2-piperazin-1-yl-5-(trifluoromethyl)pyrimidine? |
| A: InChIKey of 2-piperazin-1-yl-5-(trifluoromethyl)pyrimidine is AJPNCKCRSAVLLC-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2-piperazin-1-yl-5-(trifluoromethyl)pyrimidine? |
| A: CAS number of 2-piperazin-1-yl-5-(trifluoromethyl)pyrimidine is 745066-18-6. |
| Q: What English synonyms does 2-piperazin-1-yl-5-(trifluoromethyl)pyrimidine have? |
| A: English synonyms of 2-piperazin-1-yl-5-(trifluoromethyl)pyrimidine: PYRIMIDINE,2-(1-PIPERAZINYL)-5-(TRIFLUOROMETHYL), 2-piperazin-1-yl-5-trifluoromethyl-pyrimidine. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |