(R)-2-Acetamido-3-(1H-imidazol-4-yl)propanoic acid
(R)-2-Acetamido-3-(1H-imidazol-4-yl)propanoic acid structure
|
Common Name | (R)-2-Acetamido-3-(1H-imidazol-4-yl)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 75983-68-5 | Molecular Weight | 197.19100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H11N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | acetyl-D-histidine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H11N3O3 |
|---|---|
| Molecular Weight | 197.19100 |
| Exact Mass | 197.08000 |
| PSA | 95.08000 |
| InChIKey | KBOJOGQFRVVWBH-SSDOTTSWSA-N |
| SMILES | CC(=O)NC(Cc1cnc[nH]1)C(=O)O |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:351-50-8This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| MFCD20760261 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of acetyl-D-histidine? |
| A: CAS number of acetyl-D-histidine is 75983-68-5. |
| Q: What is the SMILES notation of acetyl-D-histidine? |
| A: SMILES notation of acetyl-D-histidine is CC(=O)NC(Cc1cnc[nH]1)C(=O)O. |
| Q: What are the downstream products of acetyl-D-histidine? |
| A: Related downstream products(CAS) of acetyl-D-histidine: 351-50-8. |
| Q: What is the molecular weight of acetyl-D-histidine? |
| A: Molecular weight of acetyl-D-histidine is 197.19100. |
| Q: What English synonyms does acetyl-D-histidine have? |
| A: English synonyms of acetyl-D-histidine: MFCD20760261. |
| Q: What is the English name of acetyl-D-histidine? |
| A: The English name of acetyl-D-histidine is acetyl-D-histidine. |
| Q: What is the molecular formula of acetyl-D-histidine? |
| A: Molecular formula of acetyl-D-histidine is C8H11N3O3. |
| Q: What is the InChIKey of acetyl-D-histidine? |
| A: InChIKey of acetyl-D-histidine is KBOJOGQFRVVWBH-SSDOTTSWSA-N. |
| Q: What is the polar surface area (PSA) of acetyl-D-histidine? |
| A: Polar surface area (PSA) of acetyl-D-histidine is 95.08000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |