2,5-Dichloro-4-(3-nitrophenoxy)pyrimidine
2,5-Dichloro-4-(3-nitrophenoxy)pyrimidine structure
|
Common Name | 2,5-Dichloro-4-(3-nitrophenoxy)pyrimidine | ||
|---|---|---|---|---|
| CAS Number | 76661-24-0 | Molecular Weight | 286.07100 | |
| Density | 1.569±0.06 g/cm3(Predicted) | Boiling Point | 432.4±40.0 °C(Predicted) | |
| Molecular Formula | C10H5Cl2N3O3 | Melting Point | 164-165 °C | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,5-Dichloro-4-(3-nitrophenoxy)pyrimidine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.569±0.06 g/cm3(Predicted) |
|---|---|
| Boiling Point | 432.4±40.0 °C(Predicted) |
| Melting Point | 164-165 °C |
| Molecular Formula | C10H5Cl2N3O3 |
| Molecular Weight | 286.07100 |
| Exact Mass | 284.97100 |
| PSA | 80.83000 |
| LogP | 4.00710 |
| InChIKey | SEGZIOXGXFJLHD-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(Oc2nc(Cl)ncc2Cl)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~89%
2,5-Dichloro-4-... CAS#:76661-24-0 |
| Literature: DANA FARBER CANCER INSTITUTE; GRAY, Nathanael, S.; JANNE, Pasi; ECK, Michael, J.; ZHOU, Wenjun Patent: WO2010/129053 A2, 2010 ; Location in patent: Page/Page column 122-123 ; WO 2010/129053 A2 |
|
~94%
2,5-Dichloro-4-... CAS#:76661-24-0 |
| Literature: Han, Chun; Huang, Zhangjian; Zheng, Chao; Wan, Ledong; Zhang, Lianwen; Peng, Sixun; Ding, Ke; Ji, Hongbin; Tian, Jide; Zhang, Yihua Journal of Medicinal Chemistry, 2013 , vol. 56, # 11 p. 4738 - 4748 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 2 | |
CAS#:1214265-56-1
CAS#:1213269-23-8This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,5-dichloro-4'-(1-pyrrolyl)benzophenone |
| Methanone,(2,5-dichlorophenyl)[4-(1H-pyrrol-1-yl)phenyl] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2,5-Dichloro-4-(3-nitrophenoxy)pyrimidine? |
| A: SMILES notation of 2,5-Dichloro-4-(3-nitrophenoxy)pyrimidine is O=[N+]([O-])c1cccc(Oc2nc(Cl)ncc2Cl)c1. |
| Q: What is the LogP of 2,5-Dichloro-4-(3-nitrophenoxy)pyrimidine? |
| A: LogP of 2,5-Dichloro-4-(3-nitrophenoxy)pyrimidine is 4.00710. |
| Q: What are the downstream products of 2,5-Dichloro-4-(3-nitrophenoxy)pyrimidine? |
| A: Related downstream products(CAS) of 2,5-Dichloro-4-(3-nitrophenoxy)pyrimidine: 1214265-56-1;1213269-23-8. |
| Q: What is the melting point of 2,5-Dichloro-4-(3-nitrophenoxy)pyrimidine? |
| A: Melting point of 2,5-Dichloro-4-(3-nitrophenoxy)pyrimidine is 164-165 °C. |
| Q: What is the InChIKey of 2,5-Dichloro-4-(3-nitrophenoxy)pyrimidine? |
| A: InChIKey of 2,5-Dichloro-4-(3-nitrophenoxy)pyrimidine is SEGZIOXGXFJLHD-UHFFFAOYSA-N. |
| Q: What is the English name of 2,5-Dichloro-4-(3-nitrophenoxy)pyrimidine? |
| A: The English name of 2,5-Dichloro-4-(3-nitrophenoxy)pyrimidine is 2,5-Dichloro-4-(3-nitrophenoxy)pyrimidine. |
| Q: What is the molecular formula of 2,5-Dichloro-4-(3-nitrophenoxy)pyrimidine? |
| A: Molecular formula of 2,5-Dichloro-4-(3-nitrophenoxy)pyrimidine is C10H5Cl2N3O3. |
| Q: What is the boiling point of 2,5-Dichloro-4-(3-nitrophenoxy)pyrimidine? |
| A: Boiling point of 2,5-Dichloro-4-(3-nitrophenoxy)pyrimidine is 432.4±40.0 °C(Predicted). |
| Q: What is the CAS number of 2,5-Dichloro-4-(3-nitrophenoxy)pyrimidine? |
| A: CAS number of 2,5-Dichloro-4-(3-nitrophenoxy)pyrimidine is 76661-24-0. |
| Q: What is the polar surface area (PSA) of 2,5-Dichloro-4-(3-nitrophenoxy)pyrimidine? |
| A: Polar surface area (PSA) of 2,5-Dichloro-4-(3-nitrophenoxy)pyrimidine is 80.83000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |