2-VINYLCYCLOPROPANE-1,1-DICARBOXYLIC ACID DIETHYL ESTER
2-VINYLCYCLOPROPANE-1,1-DICARBOXYLIC ACID DIETHYL ESTER structure
|
Common Name | 2-VINYLCYCLOPROPANE-1,1-DICARBOXYLIC ACID DIETHYL ESTER | ||
|---|---|---|---|---|
| CAS Number | 7686-78-4 | Molecular Weight | 212.24200 | |
| Density | 1.174g/cm3 | Boiling Point | 230.6ºC at 760mmHg | |
| Molecular Formula | C11H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 101.6ºC | |
Summary: Diethyl 2-ethenylcyclopropane-1,1-dicarboxylate, also known as 2-VINYLCYCLOPROPANE-1,1-DICARBOXYLIC ACID DIETHYL ESTER, with CAS number 7686-78-4, has a molecular formula of C11H16O4 and a molecular weight of 212.24200. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | diethyl 2-ethenylcyclopropane-1,1-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.174g/cm3 |
|---|---|
| Boiling Point | 230.6ºC at 760mmHg |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24200 |
| Flash Point | 101.6ºC |
| Exact Mass | 212.10500 |
| PSA | 52.60000 |
| LogP | 1.30490 |
| Index of Refraction | 1.528 |
| InChIKey | UOQTXZICFVMERR-UHFFFAOYSA-N |
| SMILES | C=CC1CC1(C(=O)OCC)C(=O)OCC |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2917209090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2917209090 |
|---|---|
| Summary | 2917209090 other cyclanic, cyclenic or cyclotherpenic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,1-dicarboethoxy-2-vinylcyclopropane |
| 1,1-bis-ethoxycarbonyl-2-vinylcyclopropane |
| ghl.PD_Mitscher_leg0.115 |
| 1,1-Cyclopropanedicarboxylic acid,2-ethenyl-,diethyl ester |
| Diethyl 2-vinylcyclopropane-1,1-dicarboxylate |
| 2-Vinylcyclopropane-1,1-dicarboxylic acid diethyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of diethyl 2-ethenylcyclopropane-1,1-dicarboxylate? |
| A: Polar surface area (PSA) of diethyl 2-ethenylcyclopropane-1,1-dicarboxylate is 52.60000. |
| Q: What is the LogP of diethyl 2-ethenylcyclopropane-1,1-dicarboxylate? |
| A: LogP of diethyl 2-ethenylcyclopropane-1,1-dicarboxylate is 1.30490. |
| Q: What English synonyms does diethyl 2-ethenylcyclopropane-1,1-dicarboxylate have? |
| A: English synonyms of diethyl 2-ethenylcyclopropane-1,1-dicarboxylate: 1,1-dicarboethoxy-2-vinylcyclopropane, 1,1-bis-ethoxycarbonyl-2-vinylcyclopropane, ghl.PD_Mitscher_leg0.115, 1,1-Cyclopropanedicarboxylic acid,2-ethenyl-,diethyl ester, Diethyl 2-vinylcyclopropane-1,1-dicarboxylate, 2-Vinylcyclopropane-1,1-dicarboxylic acid diethyl ester. |
| Q: What is the molecular formula of diethyl 2-ethenylcyclopropane-1,1-dicarboxylate? |
| A: Molecular formula of diethyl 2-ethenylcyclopropane-1,1-dicarboxylate is C11H16O4. |
| Q: What is the molecular weight of diethyl 2-ethenylcyclopropane-1,1-dicarboxylate? |
| A: Molecular weight of diethyl 2-ethenylcyclopropane-1,1-dicarboxylate is 212.24200. |
| Q: What is the English name of diethyl 2-ethenylcyclopropane-1,1-dicarboxylate? |
| A: The English name of diethyl 2-ethenylcyclopropane-1,1-dicarboxylate is diethyl 2-ethenylcyclopropane-1,1-dicarboxylate. |
| Q: What is the CAS number of diethyl 2-ethenylcyclopropane-1,1-dicarboxylate? |
| A: CAS number of diethyl 2-ethenylcyclopropane-1,1-dicarboxylate is 7686-78-4. |
| Q: What is the SMILES notation of diethyl 2-ethenylcyclopropane-1,1-dicarboxylate? |
| A: SMILES notation of diethyl 2-ethenylcyclopropane-1,1-dicarboxylate is C=CC1CC1(C(=O)OCC)C(=O)OCC. |
| Q: What is the InChIKey of diethyl 2-ethenylcyclopropane-1,1-dicarboxylate? |
| A: InChIKey of diethyl 2-ethenylcyclopropane-1,1-dicarboxylate is UOQTXZICFVMERR-UHFFFAOYSA-N. |
| Q: What is the boiling point of diethyl 2-ethenylcyclopropane-1,1-dicarboxylate? |
| A: Boiling point of diethyl 2-ethenylcyclopropane-1,1-dicarboxylate is 230.6ºC at 760mmHg. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |