((1R,3S)-3-Aminocyclopentyl)carbamic acid tert-butyl ester
((1R,3S)-3-Aminocyclopentyl)carbamic acid tert-butyl ester structure
|
Common Name | ((1R,3S)-3-Aminocyclopentyl)carbamic acid tert-butyl ester | ||
|---|---|---|---|---|
| CAS Number | 774212-81-6 | Molecular Weight | 200.27800 | |
| Density | 1.04±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H20N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tert-butyl N-[(1R,3S)-3-aminocyclopentyl]carbamate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.04±0.1 g/cm3 |
|---|---|
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.27800 |
| Exact Mass | 200.15200 |
| PSA | 67.84000 |
| LogP | 2.29560 |
| InChIKey | PGBVMVTUWHCOHX-JGVFFNPUSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CCC(N)C1 |
| Water Solubility | Slightly soluble (9 g/L) (25 ºC) |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~75%
((1R,3S)-3-Amin... CAS#:774212-81-6 |
| Literature: F. HOFFMANN-LA ROCHE AG; BERGERON, Philippe; BODIL VAN NIEL, Monique; DRAGOVICH, Peter; HURLEY, Christopher; KULAGOWSKI, Janusz; LABADIE, Sharada; MCLEAN, Neville James; MENDONCA, Rohan; PULK, Rebecca; ZAK, Mark Patent: WO2013/7765 A1, 2013 ; Location in patent: Page/Page column 168-169 ; WO 2013/007765 A1 |
|
~%
((1R,3S)-3-Amin... CAS#:774212-81-6 |
| Literature: F. HOFFMANN-LA ROCHE AG; BERGERON, Philippe; BODIL VAN NIEL, Monique; DRAGOVICH, Peter; HURLEY, Christopher; KULAGOWSKI, Janusz; LABADIE, Sharada; MCLEAN, Neville James; MENDONCA, Rohan; PULK, Rebecca; ZAK, Mark Patent: WO2013/7765 A1, 2013 ; WO 2013/007765 A1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| ((1R,3S)-3-Aminocyclopentyl)carbamic acid tert-butyl ester |
| tert-Butyl ((1R,3S)-3-aminocyclopentyl)carbamate |
| (1R,3S)-3-Amino-1-(Boc-amino)cyclopentane |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of tert-butyl N-[(1R,3S)-3-aminocyclopentyl]carbamate? |
| A: CAS number of tert-butyl N-[(1R,3S)-3-aminocyclopentyl]carbamate is 774212-81-6. |
| Q: What are the upstream materials of tert-butyl N-[(1R,3S)-3-aminocyclopentyl]carbamate? |
| A: Related upstream materials(CAS) of tert-butyl N-[(1R,3S)-3-aminocyclopentyl]carbamate: 774212-79-2;261165-05-3. |
| Q: What is the English name of tert-butyl N-[(1R,3S)-3-aminocyclopentyl]carbamate? |
| A: The English name of tert-butyl N-[(1R,3S)-3-aminocyclopentyl]carbamate is tert-butyl N-[(1R,3S)-3-aminocyclopentyl]carbamate. |
| Q: What is the LogP of tert-butyl N-[(1R,3S)-3-aminocyclopentyl]carbamate? |
| A: LogP of tert-butyl N-[(1R,3S)-3-aminocyclopentyl]carbamate is 2.29560. |
| Q: What is the molecular formula of tert-butyl N-[(1R,3S)-3-aminocyclopentyl]carbamate? |
| A: Molecular formula of tert-butyl N-[(1R,3S)-3-aminocyclopentyl]carbamate is C10H20N2O2. |
| Q: How is the water solubility of tert-butyl N-[(1R,3S)-3-aminocyclopentyl]carbamate? |
| A: Water solubility of tert-butyl N-[(1R,3S)-3-aminocyclopentyl]carbamate: Slightly soluble (9 g/L) (25 ºC). |
| Q: What English synonyms does tert-butyl N-[(1R,3S)-3-aminocyclopentyl]carbamate have? |
| A: English synonyms of tert-butyl N-[(1R,3S)-3-aminocyclopentyl]carbamate: ((1R,3S)-3-Aminocyclopentyl)carbamic acid tert-butyl ester, tert-Butyl ((1R,3S)-3-aminocyclopentyl)carbamate, (1R,3S)-3-Amino-1-(Boc-amino)cyclopentane. |
| Q: What is the polar surface area (PSA) of tert-butyl N-[(1R,3S)-3-aminocyclopentyl]carbamate? |
| A: Polar surface area (PSA) of tert-butyl N-[(1R,3S)-3-aminocyclopentyl]carbamate is 67.84000. |
| Q: What is the SMILES notation of tert-butyl N-[(1R,3S)-3-aminocyclopentyl]carbamate? |
| A: SMILES notation of tert-butyl N-[(1R,3S)-3-aminocyclopentyl]carbamate is CC(C)(C)OC(=O)NC1CCC(N)C1. |
| Q: What is the molecular weight of tert-butyl N-[(1R,3S)-3-aminocyclopentyl]carbamate? |
| A: Molecular weight of tert-butyl N-[(1R,3S)-3-aminocyclopentyl]carbamate is 200.27800. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |