(S)-1-(4-bromophenyl)-2,2,2-trifluoroethanamine
(S)-1-(4-bromophenyl)-2,2,2-trifluoroethanamine structure
|
Common Name | (S)-1-(4-bromophenyl)-2,2,2-trifluoroethanamine | ||
|---|---|---|---|---|
| CAS Number | 778565-93-8 | Molecular Weight | 254.04700 | |
| Density | N/A | Boiling Point | 270.6±40.0°C at 760 mmHg | |
| Molecular Formula | C8H7BrF3N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (1S)-1-(4-bromophenyl)-2,2,2-trifluoroethanamine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Boiling Point | 270.6±40.0°C at 760 mmHg |
|---|---|
| Molecular Formula | C8H7BrF3N |
| Molecular Weight | 254.04700 |
| Exact Mass | 252.97100 |
| PSA | 26.02000 |
| LogP | 3.71150 |
| InChIKey | ZUFCCCNTJRQNCF-ZETCQYMHSA-N |
| SMILES | NC(c1ccc(Br)cc1)C(F)(F)F |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| MFCD07374593 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of (1S)-1-(4-bromophenyl)-2,2,2-trifluoroethanamine? |
| A: Polar surface area (PSA) of (1S)-1-(4-bromophenyl)-2,2,2-trifluoroethanamine is 26.02000. |
| Q: What is the molecular formula of (1S)-1-(4-bromophenyl)-2,2,2-trifluoroethanamine? |
| A: Molecular formula of (1S)-1-(4-bromophenyl)-2,2,2-trifluoroethanamine is C8H7BrF3N. |
| Q: What is the LogP of (1S)-1-(4-bromophenyl)-2,2,2-trifluoroethanamine? |
| A: LogP of (1S)-1-(4-bromophenyl)-2,2,2-trifluoroethanamine is 3.71150. |
| Q: What is the boiling point of (1S)-1-(4-bromophenyl)-2,2,2-trifluoroethanamine? |
| A: Boiling point of (1S)-1-(4-bromophenyl)-2,2,2-trifluoroethanamine is 270.6±40.0°C at 760 mmHg. |
| Q: What is the CAS number of (1S)-1-(4-bromophenyl)-2,2,2-trifluoroethanamine? |
| A: CAS number of (1S)-1-(4-bromophenyl)-2,2,2-trifluoroethanamine is 778565-93-8. |
| Q: What is the InChIKey of (1S)-1-(4-bromophenyl)-2,2,2-trifluoroethanamine? |
| A: InChIKey of (1S)-1-(4-bromophenyl)-2,2,2-trifluoroethanamine is ZUFCCCNTJRQNCF-ZETCQYMHSA-N. |
| Q: What is the molecular weight of (1S)-1-(4-bromophenyl)-2,2,2-trifluoroethanamine? |
| A: Molecular weight of (1S)-1-(4-bromophenyl)-2,2,2-trifluoroethanamine is 254.04700. |
| Q: What is the SMILES notation of (1S)-1-(4-bromophenyl)-2,2,2-trifluoroethanamine? |
| A: SMILES notation of (1S)-1-(4-bromophenyl)-2,2,2-trifluoroethanamine is NC(c1ccc(Br)cc1)C(F)(F)F. |
| Q: What English synonyms does (1S)-1-(4-bromophenyl)-2,2,2-trifluoroethanamine have? |
| A: English synonyms of (1S)-1-(4-bromophenyl)-2,2,2-trifluoroethanamine: MFCD07374593. |
| Q: What is the English name of (1S)-1-(4-bromophenyl)-2,2,2-trifluoroethanamine? |
| A: The English name of (1S)-1-(4-bromophenyl)-2,2,2-trifluoroethanamine is (1S)-1-(4-bromophenyl)-2,2,2-trifluoroethanamine. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |