2-bromo-6,7,8,9-tetrahydro-5H-carbazole
2-bromo-6,7,8,9-tetrahydro-5H-carbazole structure
|
Common Name | 2-bromo-6,7,8,9-tetrahydro-5H-carbazole | ||
|---|---|---|---|---|
| CAS Number | 78863-99-7 | Molecular Weight | 250.13400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12BrN | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7-bromo-1,2,3,4-tetrahydrocarbazole |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H12BrN |
|---|---|
| Molecular Weight | 250.13400 |
| Exact Mass | 249.01500 |
| PSA | 15.79000 |
| LogP | 3.80920 |
| InChIKey | ZNEUGUWVPAHTNJ-UHFFFAOYSA-N |
| SMILES | Brc1ccc2c3c([nH]c2c1)CCCC3 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 4 | |
CAS#:3652-90-2
CAS#:41084-59-7
CAS#:6933-49-9
CAS#:3382-43-2This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 7-bromo-2,3,4,9-tetrahydro-1H-carbazole |
| 7-bromo-1,2,3,4-tetrahydro-carbazole |
| 7-Brom-1,2,3,4-tetrahydro-carbazol |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 7-bromo-1,2,3,4-tetrahydrocarbazole? |
| A: Molecular weight of 7-bromo-1,2,3,4-tetrahydrocarbazole is 250.13400. |
| Q: What is the English name of 7-bromo-1,2,3,4-tetrahydrocarbazole? |
| A: The English name of 7-bromo-1,2,3,4-tetrahydrocarbazole is 7-bromo-1,2,3,4-tetrahydrocarbazole. |
| Q: What is the LogP of 7-bromo-1,2,3,4-tetrahydrocarbazole? |
| A: LogP of 7-bromo-1,2,3,4-tetrahydrocarbazole is 3.80920. |
| Q: What is the InChIKey of 7-bromo-1,2,3,4-tetrahydrocarbazole? |
| A: InChIKey of 7-bromo-1,2,3,4-tetrahydrocarbazole is ZNEUGUWVPAHTNJ-UHFFFAOYSA-N. |
| Q: What English synonyms does 7-bromo-1,2,3,4-tetrahydrocarbazole have? |
| A: English synonyms of 7-bromo-1,2,3,4-tetrahydrocarbazole: 7-bromo-2,3,4,9-tetrahydro-1H-carbazole, 7-bromo-1,2,3,4-tetrahydro-carbazole, 7-Brom-1,2,3,4-tetrahydro-carbazol. |
| Q: What is the molecular formula of 7-bromo-1,2,3,4-tetrahydrocarbazole? |
| A: Molecular formula of 7-bromo-1,2,3,4-tetrahydrocarbazole is C12H12BrN. |
| Q: What is the SMILES notation of 7-bromo-1,2,3,4-tetrahydrocarbazole? |
| A: SMILES notation of 7-bromo-1,2,3,4-tetrahydrocarbazole is Brc1ccc2c3c([nH]c2c1)CCCC3. |
| Q: What are the downstream products of 7-bromo-1,2,3,4-tetrahydrocarbazole? |
| A: Related downstream products(CAS) of 7-bromo-1,2,3,4-tetrahydrocarbazole: 3652-90-2;41084-59-7;6933-49-9;3382-43-2. |
| Q: What is the polar surface area (PSA) of 7-bromo-1,2,3,4-tetrahydrocarbazole? |
| A: Polar surface area (PSA) of 7-bromo-1,2,3,4-tetrahydrocarbazole is 15.79000. |
| Q: What is the CAS number of 7-bromo-1,2,3,4-tetrahydrocarbazole? |
| A: CAS number of 7-bromo-1,2,3,4-tetrahydrocarbazole is 78863-99-7. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |