methyl 3-(benzyloxy)-4,5-dihydroxybenzoate
methyl 3-(benzyloxy)-4,5-dihydroxybenzoate structure
|
Common Name | methyl 3-(benzyloxy)-4,5-dihydroxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 79831-86-0 | Molecular Weight | 274.26900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: Methyl 3-(benzyloxy)-4,5-dihydroxybenzoate (Chinese name: 甲基苯氧基水杨酸, CAS number: 79831-86-0) is an organic compound with molecular formula C15H14O5 and molecular weight 274.26900. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 3-(benzyloxy)-4,5-dihydroxybenzoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H14O5 |
|---|---|
| Molecular Weight | 274.26900 |
| Exact Mass | 274.08400 |
| PSA | 75.99000 |
| LogP | 2.46340 |
| InChIKey | PUIWZZWMNAHWJG-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(O)c(O)c(OCc2ccccc2)c1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 10 | |
CAS#:142531-43-9
CAS#:83011-43-2
CAS#:70424-94-1
CAS#:5720-26-3
CAS#:101289-41-2
CAS#:81474-47-7
CAS#:79831-88-2
CAS#:96277-83-7
CAS#:57230-04-3
CAS#:51425-83-3This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of methyl 3-(benzyloxy)-4,5-dihydroxybenzoate? |
| A: Related downstream products(CAS) of methyl 3-(benzyloxy)-4,5-dihydroxybenzoate: 142531-43-9;83011-43-2;70424-94-1;5720-26-3;101289-41-2;81474-47-7;79831-88-2;96277-83-7;57230-04-3;51425-83-3. |
| Q: What is the SMILES notation of methyl 3-(benzyloxy)-4,5-dihydroxybenzoate? |
| A: SMILES notation of methyl 3-(benzyloxy)-4,5-dihydroxybenzoate is COC(=O)c1cc(O)c(O)c(OCc2ccccc2)c1. |
| Q: What is the English name of methyl 3-(benzyloxy)-4,5-dihydroxybenzoate? |
| A: The English name of methyl 3-(benzyloxy)-4,5-dihydroxybenzoate is methyl 3-(benzyloxy)-4,5-dihydroxybenzoate. |
| Q: What is the CAS number of methyl 3-(benzyloxy)-4,5-dihydroxybenzoate? |
| A: CAS number of methyl 3-(benzyloxy)-4,5-dihydroxybenzoate is 79831-86-0. |
| Q: What is the molecular weight of methyl 3-(benzyloxy)-4,5-dihydroxybenzoate? |
| A: Molecular weight of methyl 3-(benzyloxy)-4,5-dihydroxybenzoate is 274.26900. |
| Q: What is the polar surface area (PSA) of methyl 3-(benzyloxy)-4,5-dihydroxybenzoate? |
| A: Polar surface area (PSA) of methyl 3-(benzyloxy)-4,5-dihydroxybenzoate is 75.99000. |
| Q: What is the Chinese name of 79831-86-0? |
| A: Chinese name of 79831-86-0 is 79831-86-0. |
| Q: What is the molecular formula of methyl 3-(benzyloxy)-4,5-dihydroxybenzoate? |
| A: Molecular formula of methyl 3-(benzyloxy)-4,5-dihydroxybenzoate is C15H14O5. |
| Q: What is the LogP of methyl 3-(benzyloxy)-4,5-dihydroxybenzoate? |
| A: LogP of methyl 3-(benzyloxy)-4,5-dihydroxybenzoate is 2.46340. |
| Q: What is the InChIKey of methyl 3-(benzyloxy)-4,5-dihydroxybenzoate? |
| A: InChIKey of methyl 3-(benzyloxy)-4,5-dihydroxybenzoate is PUIWZZWMNAHWJG-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |