β-D-Glucopyranose, pentakis(2,2-dimethylpropanoate)
β-D-Glucopyranose, pentakis(2,2-dimethylpropanoate) structure
|
Common Name | β-D-Glucopyranose, pentakis(2,2-dimethylpropanoate) | ||
|---|---|---|---|---|
| CAS Number | 81058-26-6 | Molecular Weight | 600.73800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C31H52O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 1,2,3,4,6-Penta-O-trimethylacetyl-β-D-glucopyranose, also known as β-D-glucopyranose, pentakis(2,2-dimethylpropanoate), with CAS number 81058-26-6, molecular formula C31H52O11, and molecular weight 600.73800. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,2,3,4,6-penta-O-trimethylacetyl-β-D-glucopyranose |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C31H52O11 |
|---|---|
| Molecular Weight | 600.73800 |
| Exact Mass | 600.35100 |
| PSA | 140.73000 |
| LogP | 4.76360 |
| InChIKey | PLXCBOJERHYNCS-ADAARDCZSA-N |
| SMILES | CC(C)(C)C(=O)OCC1OC(OC(=O)C(C)(C)C)C(OC(=O)C(C)(C)C)C(OC(=O)C(C)(C)C)C1OC(=O)C(C)(C)C |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:81058-27-7This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| .1,2,3,4,6-penta-O-pivaloyl-β-D-glucopyranose |
| .Penta-O-pivaloyl-β-D-glucose |
| .β-D-glucose pentapivaloate |
| .1,2,3,4,6-penta-O-pivaloyl-β-D-glucose |
| 1,2,3,4,6-penta-O-pivaloyl-β-D-glucopyranose |
| .β-D-glucose pentapivalate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 1,2,3,4,6-penta-O-trimethylacetyl-β-D-glucopyranose? |
| A: LogP of 1,2,3,4,6-penta-O-trimethylacetyl-β-D-glucopyranose is 4.76360. |
| Q: What is the English name of 1,2,3,4,6-penta-O-trimethylacetyl-β-D-glucopyranose? |
| A: The English name of 1,2,3,4,6-penta-O-trimethylacetyl-β-D-glucopyranose is 1,2,3,4,6-penta-O-trimethylacetyl-β-D-glucopyranose. |
| Q: What is the CAS number of 1,2,3,4,6-penta-O-trimethylacetyl-β-D-glucopyranose? |
| A: CAS number of 1,2,3,4,6-penta-O-trimethylacetyl-β-D-glucopyranose is 81058-26-6. |
| Q: What are the downstream products of 1,2,3,4,6-penta-O-trimethylacetyl-β-D-glucopyranose? |
| A: Related downstream products(CAS) of 1,2,3,4,6-penta-O-trimethylacetyl-β-D-glucopyranose: 81058-27-7. |
| Q: What is the polar surface area (PSA) of 1,2,3,4,6-penta-O-trimethylacetyl-β-D-glucopyranose? |
| A: Polar surface area (PSA) of 1,2,3,4,6-penta-O-trimethylacetyl-β-D-glucopyranose is 140.73000. |
| Q: What English synonyms does 1,2,3,4,6-penta-O-trimethylacetyl-β-D-glucopyranose have? |
| A: English synonyms of 1,2,3,4,6-penta-O-trimethylacetyl-β-D-glucopyranose: .1,2,3,4,6-penta-O-pivaloyl-β-D-glucopyranose, .Penta-O-pivaloyl-β-D-glucose, .β-D-glucose pentapivaloate, .1,2,3,4,6-penta-O-pivaloyl-β-D-glucose, 1,2,3,4,6-penta-O-pivaloyl-β-D-glucopyranose, .β-D-glucose pentapivalate. |
| Q: What is the Chinese name of 81058-26-6? |
| A: Chinese name of 81058-26-6 is 81058-26-6. |
| Q: What is the InChIKey of 1,2,3,4,6-penta-O-trimethylacetyl-β-D-glucopyranose? |
| A: InChIKey of 1,2,3,4,6-penta-O-trimethylacetyl-β-D-glucopyranose is PLXCBOJERHYNCS-ADAARDCZSA-N. |
| Q: What is the molecular formula of 1,2,3,4,6-penta-O-trimethylacetyl-β-D-glucopyranose? |
| A: Molecular formula of 1,2,3,4,6-penta-O-trimethylacetyl-β-D-glucopyranose is C31H52O11. |
| Q: What is the SMILES notation of 1,2,3,4,6-penta-O-trimethylacetyl-β-D-glucopyranose? |
| A: SMILES notation of 1,2,3,4,6-penta-O-trimethylacetyl-β-D-glucopyranose is CC(C)(C)C(=O)OCC1OC(OC(=O)C(C)(C)C)C(OC(=O)C(C)(C)C)C(OC(=O)C(C)(C)C)C1OC(=O)C(C)(C)C. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |