Methyl 2-amino-4-methoxy-5-(phenylmethoxy)benzoate
Methyl 2-amino-4-methoxy-5-(phenylmethoxy)benzoate structure
|
Common Name | Methyl 2-amino-4-methoxy-5-(phenylmethoxy)benzoate | ||
|---|---|---|---|---|
| CAS Number | 855793-63-4 | Molecular Weight | 287.31000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 2-amino-5-(benzyloxy)-4-methoxybenzoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H17NO4 |
|---|---|
| Molecular Weight | 287.31000 |
| Exact Mass | 287.11600 |
| PSA | 70.78000 |
| LogP | 3.22420 |
| InChIKey | JWLWWDOXMYIBAM-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(OCc2ccccc2)c(OC)cc1N |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 3 | |
CAS#:286371-64-0
CAS#:286371-65-1
CAS#:909912-09-0This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| MFCD17168884 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of methyl 2-amino-5-(benzyloxy)-4-methoxybenzoate? |
| A: CAS number of methyl 2-amino-5-(benzyloxy)-4-methoxybenzoate is 855793-63-4. |
| Q: What is the molecular weight of methyl 2-amino-5-(benzyloxy)-4-methoxybenzoate? |
| A: Molecular weight of methyl 2-amino-5-(benzyloxy)-4-methoxybenzoate is 287.31000. |
| Q: What are the downstream products of methyl 2-amino-5-(benzyloxy)-4-methoxybenzoate? |
| A: Related downstream products(CAS) of methyl 2-amino-5-(benzyloxy)-4-methoxybenzoate: 286371-64-0;286371-65-1;909912-09-0. |
| Q: What is the SMILES notation of methyl 2-amino-5-(benzyloxy)-4-methoxybenzoate? |
| A: SMILES notation of methyl 2-amino-5-(benzyloxy)-4-methoxybenzoate is COC(=O)c1cc(OCc2ccccc2)c(OC)cc1N. |
| Q: What is the LogP of methyl 2-amino-5-(benzyloxy)-4-methoxybenzoate? |
| A: LogP of methyl 2-amino-5-(benzyloxy)-4-methoxybenzoate is 3.22420. |
| Q: What is the English name of methyl 2-amino-5-(benzyloxy)-4-methoxybenzoate? |
| A: The English name of methyl 2-amino-5-(benzyloxy)-4-methoxybenzoate is methyl 2-amino-5-(benzyloxy)-4-methoxybenzoate. |
| Q: What English synonyms does methyl 2-amino-5-(benzyloxy)-4-methoxybenzoate have? |
| A: English synonyms of methyl 2-amino-5-(benzyloxy)-4-methoxybenzoate: MFCD17168884. |
| Q: What is the molecular formula of methyl 2-amino-5-(benzyloxy)-4-methoxybenzoate? |
| A: Molecular formula of methyl 2-amino-5-(benzyloxy)-4-methoxybenzoate is C16H17NO4. |
| Q: What is the polar surface area (PSA) of methyl 2-amino-5-(benzyloxy)-4-methoxybenzoate? |
| A: Polar surface area (PSA) of methyl 2-amino-5-(benzyloxy)-4-methoxybenzoate is 70.78000. |
| Q: What is the InChIKey of methyl 2-amino-5-(benzyloxy)-4-methoxybenzoate? |
| A: InChIKey of methyl 2-amino-5-(benzyloxy)-4-methoxybenzoate is JWLWWDOXMYIBAM-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |