4-Iodo-2-Methoxy-1-nitrobenzene
4-Iodo-2-Methoxy-1-nitrobenzene structure
|
Common Name | 4-Iodo-2-Methoxy-1-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 860585-81-5 | Molecular Weight | 279.03200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H6INO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-methoxy-4-iodonitrobenzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H6INO3 |
|---|---|
| Molecular Weight | 279.03200 |
| Exact Mass | 278.93900 |
| PSA | 55.05000 |
| LogP | 2.73120 |
| InChIKey | HIXMWPAZDDJWNC-UHFFFAOYSA-N |
| SMILES | COc1cc(I)ccc1[N+](=O)[O-] |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:338454-80-1This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 5-iodo-2-nitro-anisole |
| 5-Jod-2-nitro-anisol |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2-methoxy-4-iodonitrobenzene? |
| A: The English name of 2-methoxy-4-iodonitrobenzene is 2-methoxy-4-iodonitrobenzene. |
| Q: What is the molecular weight of 2-methoxy-4-iodonitrobenzene? |
| A: Molecular weight of 2-methoxy-4-iodonitrobenzene is 279.03200. |
| Q: What is the molecular formula of 2-methoxy-4-iodonitrobenzene? |
| A: Molecular formula of 2-methoxy-4-iodonitrobenzene is C7H6INO3. |
| Q: What is the LogP of 2-methoxy-4-iodonitrobenzene? |
| A: LogP of 2-methoxy-4-iodonitrobenzene is 2.73120. |
| Q: What is the InChIKey of 2-methoxy-4-iodonitrobenzene? |
| A: InChIKey of 2-methoxy-4-iodonitrobenzene is HIXMWPAZDDJWNC-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2-methoxy-4-iodonitrobenzene? |
| A: CAS number of 2-methoxy-4-iodonitrobenzene is 860585-81-5. |
| Q: What English synonyms does 2-methoxy-4-iodonitrobenzene have? |
| A: English synonyms of 2-methoxy-4-iodonitrobenzene: 5-iodo-2-nitro-anisole, 5-Jod-2-nitro-anisol. |
| Q: What is the SMILES notation of 2-methoxy-4-iodonitrobenzene? |
| A: SMILES notation of 2-methoxy-4-iodonitrobenzene is COc1cc(I)ccc1[N+](=O)[O-]. |
| Q: What is the polar surface area (PSA) of 2-methoxy-4-iodonitrobenzene? |
| A: Polar surface area (PSA) of 2-methoxy-4-iodonitrobenzene is 55.05000. |
| Q: What are the downstream products of 2-methoxy-4-iodonitrobenzene? |
| A: Related downstream products(CAS) of 2-methoxy-4-iodonitrobenzene: 338454-80-1. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |