methyl 3-nitro-4-bromomethylbenzoate structure
|
Common Name | methyl 3-nitro-4-bromomethylbenzoate | ||
|---|---|---|---|---|
| CAS Number | 88089-94-5 | Molecular Weight | 274.06800 | |
| Density | N/A | Boiling Point | 364.5±32.0°C at 760 mmHg | |
| Molecular Formula | C9H8BrNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 4-(bromomethyl)-3-nitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 364.5±32.0°C at 760 mmHg |
|---|---|
| Molecular Formula | C9H8BrNO4 |
| Molecular Weight | 274.06800 |
| Exact Mass | 272.96400 |
| PSA | 72.12000 |
| LogP | 2.79950 |
| InChIKey | HYGYRBBZOHUETE-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(CBr)c([N+](=O)[O-])c1 |
| HS Code | 2916399090 |
|---|
| Precursor 7 | |
|---|---|
| DownStream 8 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Name: Trypanocidal activity against intracellular amastigote form of Trypanosoma cruzi Tula...
Source: ChEMBL
Target: Trypanosoma cruzi
External Id: CHEMBL1840098
|
|
Name: Antiparasitic activity against promastigote form of Leishmania amazonensis IFLA/BR/67...
Source: ChEMBL
Target: Leishmania amazonensis
External Id: CHEMBL1840100
|
|
Name: Selectivity index, ratio of IC50 for human PBMC to IC50 for Leishmania amazonensis IF...
Source: ChEMBL
Target: N/A
External Id: CHEMBL1840102
|
|
Name: Inhibition of cell proliferation of phytohemagglutinin-induced human PBMC
Source: ChEMBL
Target: PBMC
External Id: CHEMBL1840101
|
| 4-bromomethyl-3-nitro-benzoic acid methyl ester |
| nitro-3 bromomethyl-4 benzoate de methyle |
| methyl 3-nitro-4-bromomethylbenzoate |