5-Chloro-2-(Methylsulfonamido)benzoic Acid
5-Chloro-2-(Methylsulfonamido)benzoic Acid structure
|
Common Name | 5-Chloro-2-(Methylsulfonamido)benzoic Acid | ||
|---|---|---|---|---|
| CAS Number | 89979-12-4 | Molecular Weight | 249.67100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H8ClNO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-Chloro-2-[(methylsulfonyl)amino]benzoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H8ClNO4S |
|---|---|
| Molecular Weight | 249.67100 |
| Exact Mass | 248.98600 |
| PSA | 91.85000 |
| LogP | 2.56350 |
| InChIKey | MSJXONVQCMKJDI-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)Nc1ccc(Cl)cc1C(=O)O |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2935009090 |
|---|
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-methanesulfonamido-5-chlorobenzoic acid |
| 2-methanesulfonamido-5-benzylthiothiazole |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 5-Chloro-2-[(methylsulfonyl)amino]benzoic acid have? |
| A: English synonyms of 5-Chloro-2-[(methylsulfonyl)amino]benzoic acid: 2-methanesulfonamido-5-chlorobenzoic acid, 2-methanesulfonamido-5-benzylthiothiazole. |
| Q: What is the molecular weight of 5-Chloro-2-[(methylsulfonyl)amino]benzoic acid? |
| A: Molecular weight of 5-Chloro-2-[(methylsulfonyl)amino]benzoic acid is 249.67100. |
| Q: What is the CAS number of 5-Chloro-2-[(methylsulfonyl)amino]benzoic acid? |
| A: CAS number of 5-Chloro-2-[(methylsulfonyl)amino]benzoic acid is 89979-12-4. |
| Q: What is the InChIKey of 5-Chloro-2-[(methylsulfonyl)amino]benzoic acid? |
| A: InChIKey of 5-Chloro-2-[(methylsulfonyl)amino]benzoic acid is MSJXONVQCMKJDI-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 5-Chloro-2-[(methylsulfonyl)amino]benzoic acid? |
| A: Molecular formula of 5-Chloro-2-[(methylsulfonyl)amino]benzoic acid is C8H8ClNO4S. |
| Q: What is the LogP of 5-Chloro-2-[(methylsulfonyl)amino]benzoic acid? |
| A: LogP of 5-Chloro-2-[(methylsulfonyl)amino]benzoic acid is 2.56350. |
| Q: What is the SMILES notation of 5-Chloro-2-[(methylsulfonyl)amino]benzoic acid? |
| A: SMILES notation of 5-Chloro-2-[(methylsulfonyl)amino]benzoic acid is CS(=O)(=O)Nc1ccc(Cl)cc1C(=O)O. |
| Q: What is the English name of 5-Chloro-2-[(methylsulfonyl)amino]benzoic acid? |
| A: The English name of 5-Chloro-2-[(methylsulfonyl)amino]benzoic acid is 5-Chloro-2-[(methylsulfonyl)amino]benzoic acid. |
| Q: What is the polar surface area (PSA) of 5-Chloro-2-[(methylsulfonyl)amino]benzoic acid? |
| A: Polar surface area (PSA) of 5-Chloro-2-[(methylsulfonyl)amino]benzoic acid is 91.85000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |