3-carbamoyl-5-nitrobenzoic acid
3-carbamoyl-5-nitrobenzoic acid structure
|
Common Name | 3-carbamoyl-5-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 90196-48-8 | Molecular Weight | 210.14400 | |
| Density | 1.585g/cm3 | Boiling Point | 394.2ºC at 760mmHg | |
| Molecular Formula | C8H6N2O5 | Melting Point | 239-242ºC | |
| MSDS | N/A | Flash Point | 192.2ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-carbamoyl-5-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.585g/cm3 |
|---|---|
| Boiling Point | 394.2ºC at 760mmHg |
| Melting Point | 239-242ºC |
| Molecular Formula | C8H6N2O5 |
| Molecular Weight | 210.14400 |
| Flash Point | 192.2ºC |
| Exact Mass | 210.02800 |
| PSA | 126.21000 |
| LogP | 1.61540 |
| Index of Refraction | 1.655 |
| InChIKey | BDXFKMQTIGVLEU-UHFFFAOYSA-N |
| SMILES | NC(=O)c1cc(C(=O)O)cc([N+](=O)[O-])c1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2924299090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~89%
3-carbamoyl-5-n... CAS#:90196-48-8 |
| Literature: Schering Aktiengesellschaft Patent: EP1186305 A1, 2002 ; |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| MFCD00127687 |
| 5-Nitro-isophthalamidsaeure |
| 3-AMINOCARBONYL-5-NITROBENZOIC ACID |
| 5-nitroisophthalamic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 3-carbamoyl-5-nitrobenzoic acid? |
| A: Molecular weight of 3-carbamoyl-5-nitrobenzoic acid is 210.14400. |
| Q: What English synonyms does 3-carbamoyl-5-nitrobenzoic acid have? |
| A: English synonyms of 3-carbamoyl-5-nitrobenzoic acid: MFCD00127687, 5-Nitro-isophthalamidsaeure, 3-AMINOCARBONYL-5-NITROBENZOIC ACID, 5-nitroisophthalamic acid. |
| Q: What is the CAS number of 3-carbamoyl-5-nitrobenzoic acid? |
| A: CAS number of 3-carbamoyl-5-nitrobenzoic acid is 90196-48-8. |
| Q: What is the boiling point of 3-carbamoyl-5-nitrobenzoic acid? |
| A: Boiling point of 3-carbamoyl-5-nitrobenzoic acid is 394.2ºC at 760mmHg. |
| Q: What is the LogP of 3-carbamoyl-5-nitrobenzoic acid? |
| A: LogP of 3-carbamoyl-5-nitrobenzoic acid is 1.61540. |
| Q: What is the molecular formula of 3-carbamoyl-5-nitrobenzoic acid? |
| A: Molecular formula of 3-carbamoyl-5-nitrobenzoic acid is C8H6N2O5. |
| Q: What is the polar surface area (PSA) of 3-carbamoyl-5-nitrobenzoic acid? |
| A: Polar surface area (PSA) of 3-carbamoyl-5-nitrobenzoic acid is 126.21000. |
| Q: What is the SMILES notation of 3-carbamoyl-5-nitrobenzoic acid? |
| A: SMILES notation of 3-carbamoyl-5-nitrobenzoic acid is NC(=O)c1cc(C(=O)O)cc([N+](=O)[O-])c1. |
| Q: What are the upstream materials of 3-carbamoyl-5-nitrobenzoic acid? |
| A: Related upstream materials(CAS) of 3-carbamoyl-5-nitrobenzoic acid: 1955-46-0. |
| Q: What is the melting point of 3-carbamoyl-5-nitrobenzoic acid? |
| A: Melting point of 3-carbamoyl-5-nitrobenzoic acid is 239-242ºC. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |